Feedback

6-deoxyerythronolide B

PropertiesImageOccurences in reactions
MNX_IDMNXM2496Image of MNXM2496
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 0
formulaC21H38O6
charge0
mass386.52282
referencechebi:16089
InChIKeyHQZOLNNEQAKEHT-IBBGRPSASA-N
InChIInChI=1S/C21H38O6/c1-8-16-12(4)19(24)13(5)17(22)10(2)9-11(3)18(23)14(6)20(25)15(7)21(26)27-16/h10-16,18-20,23-25H,8-9H2,1-7H3/t10-,11+,12+,13+,14-,15-,16-,18+,19+,20+/m1/s1
SMILESCC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16089
chebi:16089
6-deoxyerythronolide B
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-ethyl-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione
3,5,11-Trihydroxyerythranolid-9-one
6,12-Dideoxy-erythronolide A
6-DEOXYERYTHRONOLIDE B
6-Deoxyerythronolide B
kegg.compound:C03240
keggC:C03240
6-Deoxyerythronolide B
seed.compound:cpd02075
seedM:cpd02075
6-Deoxyerythronolide B
6-deoxyerythronolide B
metacyc.compound:CPD-428
metacycM:CPD-428
lipidmaps:LMPK04000002
lipidmapsM:LMPK04000002
6-deoxyerythronolide B
chebi:12213
chebi:20715
chebi:2182
chebi:41952
keggC:M_C03240
seedM:M_cpd02075
secondary/obsolete/fantasy identifier