Feedback

6-deoxyerythronolide B

Properties
MNX_IDMNXM2496
formulaC21H38O6
charge0
mass386.52282
referencechebi:16089
Image of MNXM2496
InChIKeyHQZOLNNEQAKEHT-IBBGRPSASA-N
InChIInChI=1S/C21H38O6/c1-8-16-12(4)19(24)13(5)17(22)10(2)9-11(3)18(23)14(6)20(25)15(7)21(26)27-16/h10-16,18-20,23-25H,8-9H2,1-7H3/t10-,11+,12+,13+,14-,15-,16-,18+,19+,20+/m1/s1
SMILESCC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:16089 6-deoxyerythronolide B
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-ethyl-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione
3,5,11-Trihydroxyerythranolid-9-one
6,12-Dideoxy-erythronolide A
6-DEOXYERYTHRONOLIDE B
6-Deoxyerythronolide B
lipidmaps:LMPK04000002
metacycM:CPD-428
6-deoxyerythronolide B
seedM:cpd02075 6-Deoxyerythronolide B
6-deoxyerythronolide B
keggC:C03240 6-Deoxyerythronolide B
chebi:12213
chebi:20715
chebi:2182
chebi:41952
keggC:M_C03240
seedM:M_cpd02075
secondary/obsolete/fantasy identifier