Feedback

succinate

PropertiesImageOccurences in reactions
MNX_IDMNXM25Image of MNXM25
#reac
in my sandbox 0
in MNXref (generic)703
in models (compartimentalized) 267
formulaC4H4O4
charge-2
mass116.01206
referencechebi:30031
InChIKeyKDYFGRWQOYBRFD-UHFFFAOYSA-L
InChIInChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/p-2
SMILESO=C([O-])CCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113536
reactomeM:R-ALL-113536
reactome:R-ALL-159939
reactomeM:R-ALL-159939
reactome:R-ALL-1650769
reactomeM:R-ALL-1650769
reactome:R-ALL-29434
reactomeM:R-ALL-29434
reactome:R-ALL-389583
reactomeM:R-ALL-389583
reactome:R-ALL-433123
reactomeM:R-ALL-433123
CHEBI:30031
chebi:30031
succinate
(-)OOC-CH2-CH2-COO(-)
butanedioate
butanedioic acid, ion(2-)
succinate(2-)
bigg.metabolite:succ
biggM:succ
envipath:...b2ffa57fdbd7
envipathM:...b2ffa57fdbd7
SLM:000000892
slm:000000892
Succinate
CHEBI:172952
chebi:172952
Succinate_d4
2,2,3,3-tetradeuteriobutanedioate
sabiork.compound:1924
sabiorkM:1924
kegg.compound:C00042
keggC:C00042
Succinate
Butanedionic acid
Ethylenesuccinic acid
Succinic acid
seed.compound:cpd00036
seedM:cpd00036
Succinate
Butanedionic acid
Ethylenesuccinic acid
Succinic acid
butanedioic acid
ethylenesuccinic acid
suc
succ
succinate
succinic acid
hmdb:HMDB0000254 Succinic acid
1,2 Ethanedicarboxylic acid
1,2-Ethanedicarboxylate
1,2-Ethanedicarboxylic acid
1,4 Butanedioic acid
1,4-Butanedioate
1,4-Butanedioic acid
2 Acetamido 2 deoxy D glucose
2 Acetamido 2 deoxyglucose
2-Acetamido-2-deoxy-D-glucose
2-Acetamido-2-deoxyglucose
Acetylglucosamine
Acide butanedioique
Acide succinique
Acidum succinicum
Amber acid
Ammonium succinate
Asuccin
Bernsteinsaeure
Butandisaeure
Butanedioic acid
Butanedionate
Butanedionic acid
D-GlcNAc
Dihydrofumarate
Dihydrofumaric acid
Ethylenesuccinate
Ethylenesuccinic acid
HOOC-CH2-CH2-COOH
Katasuccin
N Acetyl D glucosamine
N-Acetyl-D-glucosamine
N-Acetylchitosamine
Potassium succinate
Spirit OF amber
Succinate
Succinate, ammonium
Succinate, potassium
Wormwood acid
butanedioic acid
e363
succinic acid
lipidmaps:LMFA01170043
lipidmapsM:LMFA01170043
Succinic acid
Amber acid
Butanedioic acid
Dihydrofumaric acid
FA 4:1
O2
Wormwood acid
envipath:...ff0f2389b693
envipathM:...ff0f2389b693
[butanedioic acid]
envipath:...de961c228496
envipathM:...de961c228496
compound 1248
envipath:...291175bd23e4
envipathM:...291175bd23e4
compound 39979
CHEBI:30779
chebi:30779
succinate(1-)
3-carboxypropanoate
Butanedioic acid, conjugate base
HOOC-CH2-CH2-COO(-)
hydrogen succinate
metacyc.compound:SUC
metacycM:SUC
succinate
butanedioic acid
ethylenesuccinic acid
suc
succ
succinic acid
CHEBI:90372
chebi:90372
succinic acid-d4
((2)H4)butanedioic acid
2,2,3,3-tetradeuteriosuccinic acid
succinic acid-2,2,3,3-d4
CHEBI:15741
chebi:15741
succinic acid
1,2-ethanedicarboxylic acid
Bernsteinsaeure
Butandisaeure
Butanedionic acid
Dihydrofumaric acid
E363
Ethylenesuccinic acid
HOOC-CH2-CH2-COOH
SUCCINIC ACID
Succinic acid
acide butanedioique
acide succinique
acidum succinicum
amber acid
asuccin
butanedioic acid
spirit of amber
hmdb:HMDB00254
chebi:132287
chebi:15125
chebi:22941
chebi:22943
chebi:26803
chebi:26807
chebi:45639
chebi:9304
biggM:M_succ
keggC:M_C00042
seedM:M_cpd00036
secondary/obsolete/fantasy identifier