Feedback

D-threonine

PropertiesImageOccurences in reactions
MNX_IDMNXM2514Image of MNXM2514
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 2
formulaC4H9NO3
charge0
mass119.1192
referencechebi:57757
InChIKeyAYFVYJQAPQTCCC-STHAYSLISA-N
InChIInChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m0/s1
SMILESC[C@H](O)[C@@H]([NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57757
chebi:57757
D-threonine
(2R,3S)-2-azaniumyl-3-hydroxybutanoate
D-threonine zwitterion
seed.compound:cpd00611
seedM:cpd00611
D-Threonine
(2R,3S)-2-amino-3-hydroxybutanoate
(2R,3S)-2-amino-3-hydroxybutanoic acid
D-2-Amino-3-hydroxybutyric acid
D-thr
D-threonine
sabiork.compound:2166
sabiorkM:2166
kegg.compound:C00820
keggC:C00820
D-Threonine
D-2-Amino-3-hydroxybutyric acid
CHEBI:32827
chebi:32827
D-threoninate
(2R,3S)-2-amino-3-hydroxybutanoate
D-threonine anion
metacyc.compound:D-THREONINE
metacycM:D-THREONINE
D-threonine
(2R,3S)-2-amino-3-hydroxybutanoate
(2R,3S)-2-amino-3-hydroxybutanoic acid
2-amino-3-hydroxybutyric acid
D-thr
CHEBI:16398
chebi:16398
D-threonine
(2R,3S)-2-amino-3-hydroxybutanoic acid
D-2-Amino-3-hydroxybutyric acid
D-THREONINE
D-Threonin
D-Threonine
DTH
CHEBI:32828
chebi:32828
D-threoninium
(1R,2S)-1-carboxy-2-hydroxypropan-1-aminium
D-threonine cation
chebi:13027
chebi:21107
chebi:42146
chebi:42196
chebi:42224
chebi:4254
chebi:45935
chebi:45990
keggC:M_C00820
seedM:M_cpd00611
secondary/obsolete/fantasy identifier