This is version 4.2 of MetaNetX/MNXref
 Feedback

(S)-dihydroorotate

PropertiesImageOccurences in reactions
MNX_IDMNXM252Image of MNXM252
#reac
in my sandbox 0
in MNXref (generic)54
in models (compartimentalized) 13
formulaC5H5N2O4
charge-1
mass157.10428
referencechebi:30864
InChIKeyUFIVEPVSAGBUSI-REOHCLBHSA-M
InChIInChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/p-1/t2-/m0/s1
SMILES[O-]C(=O)[C@@H]1CC(=O)NC(=O)N1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30864
chebi:30864
(S)-dihydroorotate
(4S)-2,6-dioxohexahydropyrimidine-4-carboxylate
(S)-4,5-dihydroorotate
4,5-dihydro-L-orotate
bigg.metabolite:dhor__S
biggM:dhor__S
(S)-Dihydroorotate
kegg.compound:C00337
keggC:C00337
(S)-Dihydroorotate
(S)-4,5-Dihydroorotate
Dihydro-L-orotic acid
L-Dihydroorotate
L-Dihydroorotic acid
metacyc.compound:DI-H-OROTATE
metacycM:DI-H-OROTATE
(S)-dihydroorotate
(S)-4,5-dihydroorotate
(S)-4,5-dihydroorotic acid
(S)-4-pyrimidinecarboxylic acid
(S)-di-H-orotate
(S)-hydroorotic acid
4,5-dihydro-L-orotate
4-pyrimidinecarboxylic acid, hexahydro-2,6-dioxo-
L-4,5-dihydroorotate
L-dihydroorotate
dihydro-L-orotate
reactome:R-ALL-76630
reactomeM:R-ALL-76630
CHEBI:17025
chebi:17025
(S)-dihydroorotic acid
(4S)-2,6-dioxohexahydropyrimidine-4-carboxylic acid
(S)-4,5-dihydroorotic acid
Dihydro-L-orotic acid
L-Dihydroorotic acid
sabiork.compound:2022
sabiorkM:2022
L-Dihydroorotate
(S)-4,5-Dihydroorotate
(S)-Dihydroorotate
Dihydro-L-orotic acid
L-Dihydroorotic acid
hmdb:HMDB0003349 L-Dihydroorotic acid
(4S)-2,6-dioxo-1,3-diazinane-4-carboxylic acid
(S)-4,5-Dihydroorotate
(S)-4,5-Dihydroorotic acid
(S)-Dihydroorotate
4,5-Dihydroorotic acid
4,5-Dihydroorotic acid, (D)-isomer
4,5-Dihydroorotic acid, (DL)-isomer
4,5-Dihydroorotic acid, (L)-isomer
5,6-Dihydroorotate
Dihydroorotate
Hydroorotic acid
L-Dihydroorotate
L-dihydroorotic acid
dihydro-L-Orotate
dihydro-L-Orotic acid
seed.compound:cpd00282
seedM:cpd00282
S-Dihydroorotate
(S)-4,5-Dihydroorotate
(S)-4,5-dihydroorotate
(S)-4,5-dihydroorotic acid
(S)-4-pyrimidinecarboxylic acid
(S)-Dihydroorotate
(S)-di-H-orotate
(S)-dihydroorotate
(S)-hydroorotic acid
4,5-dihydro-L-orotate
4-pyrimidinecarboxylic acid, hexahydro-2,6-dioxo-
Dihydro-L-orotic acid
L-4,5-dihydroorotate
L-Dihydroorotate
L-Dihydroorotic acid
L-dihydroorotate
dhor-S
dihydro-L-orotate
hmdb:HMDB03349
chebi:11063
chebi:18777
chebi:18778
chebi:417
chebi:42132
biggM:M_dhor__S
keggC:M_C00337
seedM:M_cpd00282
secondary/obsolete/fantasy identifier