Feedback

glycerol 2-phosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM2527Image of MNXM2527
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 10
formulaC3H7O6P
charge-2
mass170.057841
referencechebi:58083
InChIKeyDHCLVCXQIBBOPH-UHFFFAOYSA-L
InChIInChI=1S/C3H9O6P/c4-1-3(2-5)9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)/p-2
SMILESOCC(CO)OP([O-])([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58083
chebi:58083
glycerol 2-phosphate
1,3-dihydroxypropan-2-yl phosphate
2-(phosphonatooxy)propane-1,3-diol
glycerol 2-phosphate dianion
glycerol 2-phosphate(2-)
hmdb:HMDB0002520 Beta-Glycerophosphoric acid
1,2,3-Propanetriol, 2-(dihydrogen phosphate)
1,2,3-Propanetriol, 2-(dihydrogen phosphoric acid)
1,3-Hydroxy-2-propyl dihydrogen phosphate
1,3-Hydroxy-2-propyl dihydrogen phosphoric acid
2-Glycerophosphate
2-Glycerophosphoric acid
2-HYDROXY-1-(hydroxymethyl)ethyl dihydrogen phosphATE
2-HYDROXY-1-(hydroxymethyl)ethyl dihydrogen phosphoric acid
Glycerol-2-phosphate
[(1,3-dihydroxypropan-2-yl)oxy]phosphonic acid
b-Glycerophosphate
b-Glycerophosphoric acid
beta-Glycerol phosphate
beta-Glycerophosphate
beta-Glycerophosphorate
beta-Glycerophosphoric acid, calcium salt
beta-Glycerophosphoric acid, calcium salt (1:1)
beta-Glycerophosphoric acid, disodium salt
beta-Glycerophosphoric acid, iron salt
beta-Glycerophosphoric acid, iron(3+) salt(3:2)
beta-Glycerophosphoric acid, sodium salt
beta-glycerophosphate
beta-glycerophosphorate
beta-glycerophosphoric acid
bigg.metabolite:glyc2p
biggM:glyc2p
Glycerol 2-phosphate
seed.compound:cpd01908
seedM:cpd01908
Glycerol 2-phosphate
2-glycerophosphate
b-glycerol-phosphate
beta-Glycerophosphoric acid
beta-glycerol-phosphate
glyc2p
glycerol 2-phosphate
sabiork.compound:1729
sabiorkM:1729
Glycerol 2-phosphate
beta-Glycerol phosphate
beta-Glycerophosphate
kegg.compound:C02979
keggC:C02979
Glycerol 2-phosphate
beta-Glycerophosphoric acid
CHEBI:17270
chebi:17270
glycerol 2-phosphate
1,2,3-propanetriol, 2-(dihydrogen phosphate)
1,3-hydroxy-2-propyl dihydrogen phosphate
2-HYDROXY-1-(HYDROXYMETHYL)ETHYL DIHYDROGEN PHOSPHATE
2-glycerophosphate
Glycerol 2-phosphate
beta-glycerophosphate
beta-glycerophosphoric acid
glycerol 2-(dihydrogen phosphate)
metacyc.compound:CPD-536
metacycM:CPD-536
glycerol 2-phosphate
2-glycerophosphate
b-glycerol-phosphate
beta-glycerol-phosphate
hmdb:HMDB02520
chebi:14337
chebi:26704
chebi:42620
chebi:5451
biggM:M_glyc2p
keggC:M_C02979
seedM:M_cpd01908
secondary/obsolete/fantasy identifier