Feedback

2-methylpropanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2531Image of MNXM2531
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 5
formulaC4H7O2
charge-1
mass87.04515
referencechebi:48944
InChIKeyKQNPFQTWMSNSAP-UHFFFAOYSA-M
InChIInChI=1S/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)/p-1
SMILESCC(C)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:48944
chebi:48944
2-methylpropanoate
2-methylpropanoic acid, ion(1-)
2-methylpropionate
Isobutyrat
i-butyrate
iPrCO2 anion
isobutanoate
isobutyrate
isobutyric acid anion
methylpropanoate
kegg.compound:C02632
keggC:C02632
2-Methylpropanoate
2-Methylpropanoic acid
Dimethylacetic acid
Isobutanoate
Isobutyrate
Isobutyric acid
sabiork.compound:2473
sabiorkM:2473
Isobutanoate
2-Methylpropanoate
2-Methylpropanoic acid
Dimethylacetic acid
Isobutyrate
Isobutyric acid
bigg.metabolite:ibt
biggM:ibt
envipath:...ff36daf7b7fd
envipathM:...ff36daf7b7fd
Isobutyrate
seed.compound:cpd01711
seedM:cpd01711
Isobutyrate
2-Methylpropanoate
2-Methylpropanoic acid
2-methylpropanoate
2-methylpropanoic acid
2-methylpropionic acid
Dimethylacetic acid
Isobutanoate
Isobutyric acid
dimethylacetic acid
isobutanoate
isobutyrate
isobutyric acid
hmdb:HMDB0001873 Isobutyric acid
2,2-Dimethylacetate
2,2-Dimethylacetic acid
2-METHYL-propionIC ACID
2-METHYL-propionate
2-Methpropanoic acid
2-Methylpropanoate
2-Methylpropanoic acid
2-Methylpropionate
2-Methylpropionic acid
2-Methylpropionsaeure
2-methylpropanoic acid
Ammonium isobutyrate
Dimethylacetate
Dimethylacetic acid
I-butyrate
I-butyric acid
Iso-C3H7COOH
Iso-butyrate
Iso-butyric acid
Isobutanoate
Isobutanoic acid
Isobuttersaeure
Isobutyrate
Isobutyric acid, ammonium salt
Isobutyric acid, calcium salt
Isobutyric acid, hemiammoniate
Isobutyric acid, nickel salt
Isobutyric acid, potassium salt
Isobutyric acid, sodium salt
Isobutyric acid, sodium salt, 11C-labeled
Isobutyric acid, sodium salt, 14C-labeled
Isopropylformate
Isopropylformic acid
Sodium isobutyrate
a-Isobutyrate
a-Isobutyric acid
a-Methylpropanoate
a-Methylpropanoic acid
a-Methylpropionate
a-Methylpropionic acid
alpha-Isobutyrate
alpha-Isobutyric acid
alpha-Methylpropanoate
alpha-Methylpropanoic acid
alpha-Methylpropionate
alpha-Methylpropionic acid
alpha-isobutyrate
alpha-isobutyric acid
alpha-methylpropanoate
alpha-methylpropanoic acid
alpha-methylpropionate
alpha-methylpropionic acid
isobutyric acid
lipidmaps:LMFA01020071
lipidmapsM:LMFA01020071
Isobutyric acid
2-methyl-propanoic acid
FA 4:0
envipath:...88261a98ca92
envipathM:...88261a98ca92
compound 38802
metacyc.compound:ISOBUTYRATE
metacycM:ISOBUTYRATE
isobutanoate
2-methylpropanoate
2-methylpropanoic acid
2-methylpropionic acid
dimethylacetic acid
isobutyrate
isobutyric acid
CHEBI:16135
chebi:16135
isobutyric acid
2,2-dimethylacetic acid
2-METHYL-PROPIONIC ACID
2-Methylpropanoate
2-Methylpropanoic acid
2-Methylpropionsaeure
2-methylpropanoic acid
Dimethylacetic acid
ISOBUTYRIC ACID
Isobutanoate
Isobuttersaeure
Isobutyrate
Isobutyric acid
alpha-isobutyric acid
alpha-methylpropanoic acid
alpha-methylpropionic acid
iso-C3H7COOH
iso-butyric acid
isobutanoic acid
isopropylformic acid
hmdb:HMDB0003151
hmdb:HMDB01873
hmdb:HMDB03151
chebi:11627
chebi:1212
chebi:19710
chebi:25334
chebi:25337
chebi:40653
chebi:43397
biggM:M_ibt
keggC:M_C02632
seedM:M_cpd01711
secondary/obsolete/fantasy identifier