Feedback

heptanedioate

PropertiesImageOccurences in reactions
MNX_IDMNXM2555Image of MNXM2555
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 5
formulaC7H10O4
charge-2
mass158.05901
referencechebi:36165
InChIKeyWLJVNTCWHIRURA-UHFFFAOYSA-L
InChIInChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11)/p-2
SMILESO=C([O-])CCCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36165
chebi:36165
heptanedioate
pimelate(2-)
bigg.metabolite:pime
biggM:pime
Pimelate
seed.compound:cpd01727
seedM:cpd01727
Pimelate
6-Carboxyhexanoate
6-carboxyhexanoate
Heptanedioic acid
Pimelic acid
heptanedioate
pime
pimelate
pimelic acid
kegg.compound:C02656
keggC:C02656
Pimelate
6-Carboxyhexanoate
Heptanedioic acid
Pimelic acid
hmdb:HMDB0000857 Pimelic acid
1,5-Pentanedicarboxylate
1,5-Pentanedicarboxylic acid
1,7-Heptanedioate
1,7-Heptanedioic acid
6-Carboxyhexanoate
6-Carboxyhexanoic acid
Acid, pimelic
Acids, pimelic
Heptandioate
Heptandioic acid
Heptane-1,7-dioate
Heptane-1,7-dioic acid
Heptanedioate
Heptanedioic acid
Pilerate
Pileric acid
Pimelate
Pimelic acids
heptanedioic acid
pimelic acid
lipidmaps:LMFA01170051
lipidmapsM:LMFA01170051
Pimelic acid
FA 7:1
Heptanedioic acid
O2
CHEBI:17774
chebi:17774
pimelate(1-)
6-carboxyhexanoate
Pimelate
heptanedioate
hydrogen pimelate
metacyc.compound:CPD-205
metacycM:CPD-205
pimelate
6-carboxyhexanoate
heptanedioate
pimelic acid
CHEBI:133773
chebi:133773
pimelate
heptanedioic acid anion
heptanedioic acid anions
pimelates
pimelic acid anion
pimelic acid anions
CHEBI:30531
chebi:30531
pimelic acid
1,5-pentanedicarboxylic acid
6-carboxyhexanoic acid
Heptanedioic acid
PIMELIC ACID
Pimelate
Pimelic acid
heptanedioic acid
hmdb:HMDB00857
chebi:12209
chebi:20708
chebi:20709
chebi:2175
chebi:24517
chebi:44980
biggM:M_pime
keggC:M_C02656
seedM:M_cpd01727
secondary/obsolete/fantasy identifier