Feedback

heptanedioate

Properties
MNX_IDMNXM2555
formulaC7H10O4
charge-2
mass158.1519
referencechebi:36165
Image of MNXM2555
InChIKeyWLJVNTCWHIRURA-UHFFFAOYSA-L
InChIInChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11)/p-2
SMILES[O-]C(=O)CCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
keggC:C02656 Pimelate
6-Carboxyhexanoate
Heptanedioic acid
Pimelic acid
chebi:36165 heptanedioate
pimelate(2-)
biggM:M_pime
chebi:12209
chebi:20708
chebi:20709
chebi:2175
chebi:24517
chebi:44980
hmdb:HMDB00857
keggC:M_C02656
seedM:M_cpd01727
secondary/obsolete/fantasy identifier
metacycM:CPD-205 pimelate
6-carboxyhexanoate
heptanedioate
pimelic acid
hmdb:HMDB0000857 Pimelic acid
1,5-Pentanedicarboxylate
1,5-Pentanedicarboxylic acid
1,7-Heptanedioate
1,7-Heptanedioic acid
6-Carboxyhexanoate
6-Carboxyhexanoic acid
Acid, pimelic
Acids, pimelic
Heptandioate
Heptandioic acid
Heptane-1,7-dioate
Heptane-1,7-dioic acid
Heptanedioate
Heptanedioic acid
Pilerate
Pileric acid
Pimelate
Pimelic acids
heptanedioic acid
pimelic acid
chebi:133773 pimelate
heptanedioic acid anion
heptanedioic acid anions
pimelates
pimelic acid anion
pimelic acid anions
chebi:17774 pimelate(1-)
6-carboxyhexanoate
Pimelate
heptanedioate
hydrogen pimelate
chebi:30531 pimelic acid
1,5-pentanedicarboxylic acid
6-carboxyhexanoic acid
Heptanedioic acid
PIMELIC ACID
Pimelate
Pimelic acid
heptanedioic acid
lipidmaps:LMFA01170051 Pimelic acid
Heptanedioic acid
biggM:pime Pimelate
seedM:cpd01727 Pimelate
6-Carboxyhexanoate
6-carboxyhexanoate
Heptanedioic acid
Pimelic acid
heptanedioate
pime
pimelate
pimelic acid