Feedback

thiomorpholine-3-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM2566Image of MNXM2566
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC5H9NO2S
charge0
mass147.1965
referencechebi:58047
InChIKeyJOKIQGQOKXGHDV-UHFFFAOYSA-N
InChIInChI=1S/C5H9NO2S/c7-5(8)4-3-9-2-1-6-4/h4,6H,1-3H2,(H,7,8)
SMILES[O-]C(=O)C1CSCC[NH2+]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58047
chebi:58047
thiomorpholine-3-carboxylate
thiomorpholin-4-ium-3-carboxylate
thiomorpholine-3-carboxylic acid zwitterion
kegg.compound:C03901
keggC:C03901
Thiomorpholine 3-carboxylate
hmdb:HMDB0059611 Thiomorpholine 3-carboxylate
1,4-TMCA
1,4-Thiomorpholine-3-carboxylate
1,4-Thiomorpholine-3-carboxylic acid
3-Thiomorpholinecarboxylate
3-Thiomorpholinecarboxylic acid
Thiomorpholine 3-carboxylic acid
Thiomorpholine-3-carboxylate
thiomorpholine 3-carboxylate
thiomorpholine-3-carboxylic acid
seed.compound:cpd02427
seedM:cpd02427
Thiomorpholine 3-carboxylate
thiomorpholine-3-carboxylate
metacyc.compound:THIOMORPHOLINE-3-CARBOXYLATE
metacycM:THIOMORPHOLINE-3-CARBOXYLATE
CHEBI:15237
chebi:15237
thiomorpholine-3-carboxylate
CHEBI:17195
chebi:17195
thiomorpholine-3-carboxylic acid
1,4-thiomorpholine-3-carboxylic acid
3-thiomorpholinecarboxylic acid
Thiomorpholine 3-carboxylate
hmdb:HMDB59611
chebi:9559
keggC:M_C03901
seedM:M_cpd02427
secondary/obsolete/fantasy identifier