Feedback

dTMP

PropertiesImageOccurences in reactions
MNX_IDMNXM257Image of MNXM257
#reac
in my sandbox 0
in MNXref (generic)44
in models (compartimentalized) 49
formulaC10H13N2O8P
charge-2
mass320.04205
referencechebi:63528
InChIKeyGYOZYWVXFNDGLU-XLPZGREQSA-L
InChIInChI=1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/p-2/t6-,7+,8+/m0/s1
SMILESCc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])[O-])O2)c(=O)[nH]c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:63528
chebi:63528
dTMP
5'-O-phosphonatothymidine
5-methyluridine 5'-phosphate
TMP dianion
dTMP(2-)
ribothymidine 5'-monophosphate anion
thymidine 5'-monophosphate
thymidine 5'-phosphate
thymidine 5'-phosphate(2-)
hmdb:HMDB0001227 5-Thymidylic acid
(DT)1
2'-Deoxythymidine 5'-monophosphate
5'-TMP
5'-Thymidylate
5'-Thymidylic acid
5'-dTMP
5-Methyl-dUMP
5-Thymidylate
Acid, thymidylic
Acids, thymidylic
Deoxy TMP
Deoxyribosylthymine monophosphate
Deoxyribosylthymine monophosphoric acid
Deoxythymidine 5'-monophosphate
Deoxythymidine 5'-phosphate
Deoxythymidine 5'-phosphoric acid
Deoxythymidine monophosphate
Deoxythymidylate
Deoxythymidylic acid
Deoxythymydilate
Deoxythymydilic acid
Ribothymidine 5'-monophosphate
Ribothymidine 5'-monophosphoric acid
THYMIDINE-5'-phosphATE
THYMIDINE-5'-phosphoric acid
TMP
Thymidine 5'-(dihydrogen phosphate)
Thymidine 5'-(dihydrogen phosphoric acid)
Thymidine 5'-monophosphate
Thymidine 5'-phosphate
Thymidine 5'-phosphorate
Thymidine 5'-phosphoric acid
Thymidine 5'MP
Thymidine mononucleotide
Thymidine monophosphate
Thymidine monophosphoric acid
Thymidine phosphate
Thymidine-5'-monophosphate
Thymidine-5'-monophosphorate
Thymidine-5'-monophosphoric acid
Thymidylate
Thymidylic acid
Thymidylic acids
dTMP
monoPhosphate, thymidine
thymidylate
{[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)oxolan-2-yl]methoxy}phosphonic acid
bigg.metabolite:dtmp
biggM:dtmp
DTMP
CHEBI:46960
chebi:46960
dTMP(-)
5'-O-(hydroxyphosphinato)thymidine
thymidine 5'-(hydrogen phosphate)
thymidine 5'-phosphate(1-)
reactome:R-ALL-109292
reactomeM:R-ALL-109292
reactome:R-ALL-109366
reactomeM:R-ALL-109366
reactome:R-ALL-109509
reactomeM:R-ALL-109509
CHEBI:17013
chebi:17013
dTMP
(dT)1
2'-deoxy-5-methyluridine 5'-(dihydrogen phosphate)
5'-TMP
5'-Thymidylic acid
5'-thymidylic acid
5-methyl-dUMP
THYMIDINE-5'-PHOSPHATE
TMP
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
Thymidylic acid
deoxyribosylthymine monophosphate
ribothymidine 5'-monophosphate
thymidine 5'-(dihydrogen phosphate)
thymidine 5'-phosphoric acid
thymidine-5'-monophosphoric acid
seed.compound:cpd00298
seedM:cpd00298
dTMP
5'-Thymidylic acid
5'-thymidylic acid
Deoxythymidine 5'-phosphate
Deoxythymidylic acid
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
Thymidylic acid
deoxythymidine 5'-phosphate
deoxythymidylate
deoxythymidylic acid
dtmp
thymidine 5'-monophosphate
thymidine 5'-phosphate
thymidine monophosphate
thymidine-5'-monophosphate
thymidine-5'-phosphate
thymidine-phosphate
thymidylate
thymidylic acid
sabiork.compound:65
sabiorkM:65
kegg.compound:C00364
keggC:C00364
dTMP
5'-Thymidylic acid
Deoxythymidine 5'-phosphate
Deoxythymidylic acid
Thymidine 5'-phosphate
Thymidine monophosphate
Thymidylate
Thymidylic acid
metacyc.compound:TMP
metacycM:TMP
dTMP
5'-thymidylic acid
TMP
deoxythymidine 5'-phosphate
deoxythymidylate
deoxythymidylic acid
thymidine 5'-monophosphate
thymidine 5'-phosphate
thymidine monophosphate
thymidine-phosphate
thymidylate
thymidylic acid
hmdb:HMDB01227
chebi:10529
chebi:14092
chebi:15246
chebi:26999
chebi:45759
chebi:45772
chebi:45926
chebi:46013
chebi:46036
chebi:47711
chebi:63549
biggM:M_dtmp
keggC:M_C00364
seedM:M_cpd00298
secondary/obsolete/fantasy identifier