Feedback

(1S,6R)-1,6-dihydroxy-4-methylcyclohexa-2,4-diene-1-carboxylic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM2571Image of MNXM2571
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC8H9O4
charge-1
mass169.15466
referencechebi:49009
InChIKeyKWQSYZVAOWYCNP-SVRRBLITSA-M
InChIInChI=1S/C8H10O4/c1-5-2-3-8(12,7(10)11)6(9)4-5/h2-4,6,9,12H,1H3,(H,10,11)/p-1/t6-,8+/m1/s1
SMILESCC1=C[C@@H](O)[C@@](O)(C=C1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:49009
chebi:49009
(1S,6R)-1,6-dihydroxy-4-methylcyclohexa-2,4-diene-1-carboxylic acid