Feedback

(3R)-3-hydroxy-D-aspartate

Properties
MNX_IDMNXM2574
formulaC4H6NO5
charge-1
mass148.09418
referencechebi:60898
Image of MNXM2574
InChIKeyYYLQUHNPNCGKJQ-JCYAYHJZSA-M
InChIInChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/p-1/t1-,2-/m1/s1
SMILES[NH3+][C@H]([C@@H](O)C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:60897 (3R)-3-hydroxy-D-aspartic acid
(2R,3R)-2-amino-3-hydroxybutanedioic acid
(2R,3R)-2-amino-3-hydroxysuccinic acid
(R,R)-3-hydroxyaspartic acid
D-threo-3-hydroxyaspartic acid
D-threo-beta-hydroxyaspartic acid
threo-3-hydroxy-D-aspartic acid
threo-D-3-hydroxyaspartic acid
threo-beta-hydroxy-D-aspartic acid
keggC:C19813 threo-3-Hydroxy-D-aspartate
sabiorkM:29837 D-threo-3-Hydroxyaspartate
chebi:60898 (3R)-3-hydroxy-D-aspartate
(2R,3R)-2-ammonio-3-hydroxybutanedioate
(3R)-3-hydroxy-D-aspartate(1-)
D-threo-3-hydroxyaspartate
threo-3-hydroxy-D-aspartate
threo-beta-hydroxy-D-aspartate
seedM:cpd21056 threo-3-Hydroxy-D-aspartate
(3R)-3-hydroxy-D-aspartate
D-threo-3-hydroxyaspartate
D-threo-beta-hydroxyaspartate
threo-3-hydroxy-D-aspartate
threo-beta-hydroxy-D-aspartate
metacycM:CPD-12738 (3R)-3-hydroxy-D-aspartate
D-threo-3-hydroxyaspartate
D-threo-beta-hydroxyaspartate
threo-3-hydroxy-D-aspartate
threo-beta-hydroxy-D-aspartate
keggC:M_C19813
seedM:M_cpd21056
secondary/obsolete/fantasy identifier