Feedback

(Z)-2-methylureidoacrylate peracid

Properties
MNX_IDMNXM2585
formulaC5H8N2O4
charge0
mass160.1281
referencechebi:63249
Image of MNXM2585
InChIKeyGHIKATUDZMBUJC-IHWYPQMZSA-N
InChIInChI=1S/C5H8N2O4/c1-3(4(8)11-10)2-7-5(6)9/h2,10H,1H3,(H3,6,7,9)/b3-2-
SMILESC\C(=C\NC(N)=O)C(=O)OO

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd21465 (Z)-2-Methylureidoacrylate peracid
(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
(Z)-2-methylureidoacrylate peracid
(Z)-2-methylureidoperacrylic acid
keggC:C20232 (Z)-2-Methylureidoacrylate peracid
chebi:63249 (Z)-2-methylureidoacrylate peracid
(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
(Z)-2-methyl-ureidoacrylate peracid
(Z)-2-methylureidoperacrylic acid
metacycM:CPD-13927 (Z)-2-methylureidoacrylate peracid
(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
(Z)-2-methylureidoperacrylic acid
keggC:M_C20232
seedM:M_cpd21465
secondary/obsolete/fantasy identifier