Feedback

(Z)-2-methylureidoacrylate peracid

PropertiesImageOccurences in reactions
MNX_IDMNXM2585Image of MNXM2585
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC5H8N2O4
charge0
mass160.1281
referencechebi:63249
InChIKeyGHIKATUDZMBUJC-IHWYPQMZSA-N
InChIInChI=1S/C5H8N2O4/c1-3(4(8)11-10)2-7-5(6)9/h2,10H,1H3,(H3,6,7,9)/b3-2-
SMILESC\C(=C\NC(N)=O)C(=O)OO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:63249
chebi:63249
(Z)-2-methylureidoacrylate peracid
(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
(Z)-2-methyl-ureidoacrylate peracid
(Z)-2-methylureidoperacrylic acid
kegg.compound:C20232
keggC:C20232
(Z)-2-Methylureidoacrylate peracid
seed.compound:cpd21465
seedM:cpd21465
(Z)-2-Methylureidoacrylate peracid
(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
(Z)-2-methylureidoacrylate peracid
(Z)-2-methylureidoperacrylic acid
metacyc.compound:CPD-13927
metacycM:CPD-13927
(Z)-2-methylureidoacrylate peracid
(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
(Z)-2-methylureidoperacrylic acid
keggC:M_C20232
seedM:M_cpd21465
secondary/obsolete/fantasy identifier