Feedback

2',3'-cyclic AMP

Properties
MNX_IDMNXM2598
formulaC10H11N5O6P
charge-1
mass328.198201
referencechebi:60879
Image of MNXM2598
InChIKeyKMYWVDDIPVNLME-KQYNXXCUSA-M
InChIInChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7-6(4(1-16)19-10)20-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/p-1/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@H]2OP([O-])(=O)O[C@@H]12

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd01570 2',3'-Cyclic AMP
(2R,3aR,4R,6R,6aR)-4-(6-amino-9H-purin-9-yl)-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-2-ol 2-oxide
(3aR,4R,6R,6aR)-4-(6-amino-9H-purin-9-yl)-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-2-ol 2-oxide
23camp
adenosine 2',3'-(hydrogen phosphate)
adenosine 2',3'-cyclic monophosphate
adenosine 2'3'-cyclic monophosphate
adenosine cyclic 2',3'-(hydrogen phosphate)
cyclic 2',3'-AMP
cyclic 2',3'-adenosine monophosphate
biggM:M_23camp
chebi:19212
chebi:40469
chebi:823
hmdb:HMDB11616
keggC:M_C02353
seedM:M_cpd01570
secondary/obsolete/fantasy identifier
chebi:27844 2',3'-cyclic AMP
(3aR,4R,6R,6aR)-4-(6-amino-9H-purin-9-yl)-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-2-ol 2-oxide
2',3'-Cyclic AMP
adenosine 2',3'-(hydrogen phosphate)
adenosine cyclic 2',3'-(hydrogen phosphate)
hmdb:HMDB0011616 Adenosine 2',3'-cyclic phosphate
2',3'-CAMP
2',3'-Cyclic AMP
2',3'-Cyclic AMP, monosodium salt
2',3'-Cyclic AMP, sodium salt
2',3'-Cyclic adenosine monophosphate
4-(6-amino-9H-purin-9-yl)-2-hydroxy-6-(hydroxymethyl)-tetrahydro-2H-2lambda⁵-furo[3,4-d][1,3,2]dioxaphosphol-2-one
4-(6-aminopurin-9-yl)-2-hydroxy-6-(hydroxymethyl)-tetrahydro-2lambda⁵-furo[3,4-d][1,3,2]dioxaphosphol-2-one
Adenosine cyclic 2',3'-monophosphate
Adenosine cyclic 2,3 monophosphate
Adenosine cyclic-2',3'-monophosphate
Cyclic 2',3'-(hydrogen phosphate)-adenosine
Cyclic 2',3'-AMP
metacycM:CPD-3707 adenosine 2',3'-cyclic monophosphate
(2R,3aR,4R,6R,6aR)-4-(6-amino-9H-purin-9-yl)-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-2-ol 2-oxide
(3aR,4R,6R,6aR)-4-(6-amino-9H-purin-9-yl)-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-2-ol 2-oxide
2',3'-Cyclic AMP
adenosine 2',3'-(hydrogen phosphate)
adenosine cyclic 2',3'-(hydrogen phosphate)
cyclic 2',3'-AMP
cyclic 2',3'-adenosine monophosphate
chebi:60879 2',3'-cyclic AMP
2',3'-cyclic AMP(1-)
adenosine 2',3'-phosphate
biggM:23camp
keggC:C02353
sabiorkM:1882
2',3'-Cyclic AMP
MNXM491074is deprecated and replaced by this entry