Feedback

acetate

PropertiesImageOccurences in reactions
MNX_IDMNXM26Image of MNXM26
#reac
in my sandbox 0
in MNXref (generic)551
in models (compartimentalized) 237
formulaC2H3O2
charge-1
mass59.01385
referencechebi:30089
InChIKeyQTBSBXVTEAMEQO-UHFFFAOYSA-M
InChIInChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1
SMILESCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113539
reactomeM:R-ALL-113539
reactome:R-ALL-1524044
reactomeM:R-ALL-1524044
reactome:R-ALL-5566518
reactomeM:R-ALL-5566518
CHEBI:30089
chebi:30089
acetate
ACETATE ION
Azetat
CH3-COO(-)
Ethanoat
MeCO2 anion
acetic acid, ion(1-)
ethanoate
bigg.metabolite:ac
biggM:ac
envipath:...efa015b481ea
envipathM:...efa015b481ea
Acetate
seed.compound:cpd00029
seedM:cpd00029
Acetate
ACET
Acetic acid
Ethanoic acid
Glacial acetic acid
ac
acetate
acetic acid
ethanoic acid
kegg.compound:C00033
keggC:C00033
Acetate
Acetic acid
Ethanoic acid
sabiork.compound:1278
sabiorkM:1278
Acetate
Acetic acid
Ethanoic acid
Glacial acetic acid
envipath:...3be380a9d3c0
envipathM:...3be380a9d3c0
Acetic acid
kegg.drug:D00010
keggD:D00010
Acetic acid, glacial (USP)
Acetasol (TN)
Acetic acid (JP18/NF)
Glacial acetic acid (JP18)
lipidmaps:LMFA01010002
lipidmapsM:LMFA01010002
Acetic acid
10.Methanecarboxylic acid
C2:0
FA 2:0
Vinegar acid
acetate
ethanoic acid
hmdb:HMDB0000042 Acetic acid
AcOH
Acetasol
Acetate
Acetic acid glacial
Acetic acid, glacial
Acid glacial, acetic
Acid, acetic
Acid, glacial acetic
Acide acetique
CH3-COOH
CH3CO2H
Essigsaeure
Ethanoate
Ethanoic acid
Ethoate
Ethoic acid
Ethylate
Ethylic acid
Glacial acetate
Glacial acetic acid
Glacial, acetic acid
HOAc
INS no. 260
Kyselina octova
MeCO2h
MeCOOH
Methanecarboxylate
Methanecarboxylic acid
Vinegar
Vinegar acid
acetic acid
e 260
e-260
e260
SLM:000000449
slm:000000449
acetate
metacyc.compound:ACET
metacycM:ACET
acetate
ethanoic acid
reactome:R-ALL-2022890
reactomeM:R-ALL-2022890
reactome:R-ALL-29416
reactomeM:R-ALL-29416
reactome:R-ALL-372540
reactomeM:R-ALL-372540
reactome:R-ALL-390305
reactomeM:R-ALL-390305
reactome:R-ALL-427486
reactomeM:R-ALL-427486
CHEBI:15366
chebi:15366
acetic acid
ACETIC ACID
AcOH
Acetic acid
CH3-COOH
CH3CO2H
E 260
E-260
E260
Essigsaeure
Ethanoic acid
Ethylic acid
HOAc
INS No. 260
MeCO2H
MeCOOH
Methanecarboxylic acid
acide acetique
ethoic acid
metacyc.compound:CPD-24335
metacycM:CPD-24335
acetic acid
ethanoic acid
envipath:...9f03545032d2
envipathM:...9f03545032d2
compound 250
envipath:...163c627e9b4a
envipathM:...163c627e9b4a
compound 37936
envipath:...a516a0ead4b3
envipathM:...a516a0ead4b3
compound 40212
envipath:...91a3d615e3d8
envipathM:...91a3d615e3d8
compound 76
hmdb:HMDB00042
chebi:13704
chebi:22165
chebi:22169
chebi:2387
chebi:40480
chebi:40486
biggM:M_ac
keggC:M_C00033
keggD:M_D00010
seedM:M_cpd00029
secondary/obsolete/fantasy identifier