Feedback

2,4-dichlorophenol

PropertiesImageOccurences in reactions
MNX_IDMNXM2600Image of MNXM2600
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC6H4Cl2O
charge0
mass161.96392
referencechebi:16738
InChIKeyHFZWRUODUSTPEG-UHFFFAOYSA-N
InChIInChI=1S/C6H4Cl2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H
SMILESOc1ccc(Cl)cc1Cl
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16738
chebi:16738
2,4-dichlorophenol
2,4-Dichlorophenol
sabiork.compound:2470
sabiorkM:2470
envipath:...d12ede128487
envipathM:...d12ede128487
kegg.compound:C02625
keggC:C02625
2,4-Dichlorophenol
hmdb:HMDB0004811 2,4-Dichlorophenol
1,3-Dichloro-4-hydroxybenzene
2,4-Dichloro-phenol
2,4-Dichlorophenate
2,4-Dichlorophenic acid
2,4-Dichlorophenol potassium
2,4-Dichlorophenol sodium
2,4-Dichlorophenol, 14C-labeled CPD
2,4-dichlorophenol
24-Dichlorophenol
4,6-Dichlorophenol
seed.compound:cpd01706
seedM:cpd01706
2,4-Dichlorophenol
2,4-dichlorophenol
envipath:...43e947ecebe7
envipathM:...43e947ecebe7
2,4-Dichlorophenol
2.4-DCP
metacyc.compound:24-DICHLOROPHENOL
metacycM:24-DICHLOROPHENOL
2,4-dichlorophenol
envipath:...61077bfb20f3
envipathM:...61077bfb20f3
compound 38547
hmdb:HMDB04811
chebi:11440
chebi:19350
chebi:909
keggC:M_C02625
seedM:M_cpd01706
secondary/obsolete/fantasy identifier