Feedback

6-acetamido-2-oxohexanoate

Properties
MNX_IDMNXM2603
formulaC8H12NO4
charge-1
mass186.18522
referencechebi:79192
Image of MNXM2603
InChIKeyNGCXIFFZXAZRAF-UHFFFAOYSA-M
InChIInChI=1S/C8H13NO4/c1-6(10)9-5-3-2-4-7(11)8(12)13/h2-5H2,1H3,(H,9,10)(H,12,13)/p-1
SMILESCC(=O)NCCCCC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:C05548 6-Acetamido-2-oxohexanoate
2-Oxo-6-acetamidocaproate
metacycM:2-KETO-6-ACETAMIDOCAPROATE 2-keto-6-acetamidocaproate
2-keto-6-acetamidohexanoate
2-oxo-6-acetamidocaproate
6-acetamido-2-oxohexanoate
chebi:79192 6-acetamido-2-oxohexanoate
2-keto-6-acetamidocaproate
2-keto-6-acetamidohexanoate
2-oxo-6-acetamidocaproate
6-(acetylamino)-2-oxohexanoate
seedM:cpd03291 2-Oxo-6-acetamidocaproate
2-keto-6-acetamidocaproate
2-keto-6-acetamidohexanoate
2-oxo-6-acetamidocaproate
6-Acetamido-2-oxohexanoate
6-acetamido-2-oxohexanoate
hmdb:HMDB0012150 2-Keto-6-acetamidocaproate
2-keto-6-Acetamidocaproic acid
2-keto-6-Acetamidohexanoate
2-keto-6-Acetamidohexanoic acid
2-oxo-6-Acetamidocaproate
2-oxo-6-Acetamidocaproic acid
6-acetamido-2-Oxohexanoate
6-acetamido-2-Oxohexanoic acid
6-acetamido-2-oxohexanoic acid
chebi:28376 6-acetamido-2-oxohexanoic acid
2-Keto-6-acetamidocaproic acid
2-Keto-6-acetamidohexanoic acid
2-Oxo-6-acetamidocaproic acid
6-(acetylamino)-2-oxohexanoic acid
6-Acetamido-2-oxohexanoic acid
chebi:20690
chebi:2163
hmdb:HMDB12150
keggC:M_C05548
seedM:M_cpd03291
secondary/obsolete/fantasy identifier
MNXM38553is deprecated and replaced by this entry