|
![]() |
InChIKey | JBGHTSSFSSUKLR-UHFFFAOYSA-N |
InChI | InChI=1S/C6H5NO6S/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H,10,11,12) |
SMILES | OS(=O)(=O)Oc1ccc(cc1)[N+]([O-])=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 3 |
Distinct compatimentalized reactions in models | 3 |
Identifier | Description |
---|---|
chebi:35422 reactome:R-ALL-176600 | 4-nitrophenyl hydrogen sulfate 4-nitrophenyl sulfate p-nitrophenol sulfate p-nitrophenyl sulfate para-nitrophenyl sulfate sulfuric acid mono(4-nitrophenyl) ester |
hmdb:HMDB0006492 | 4-Nitrophenyl sulfate (4-nitrophenyl)oxidanesulfonic acid 4-Nitrophenyl 4-Nitrophenyl sulfate, ion (1-) 4-Nitrophenyl sulfate, potassium salt 4-Nitrophenyl sulfate, sodium salt 4-Nitrophenyl sulfuric acid 4-Nitrophenyl sulphate 4-Nitrophenyl sulphuric acid P-Nitrophenol sulfate P-Nitrophenol sulfuric acid P-Nitrophenol sulphate P-Nitrophenol sulphuric acid P-Nitrophenyl sulfate P-Nitrophenyl sulfuric acid P-Nitrophenyl sulphate P-Nitrophenyl sulphuric acid P-nitro-Phenol P-nitrophenyl sulfate Para-nitrophenyl sulfate Para-nitrophenyl sulfuric acid Para-nitrophenyl sulphate Para-nitrophenyl sulphuric acid Sulfate mono(4-nitrophenyl) ester Sulfuric acid mono(4-nitrophenyl) ester Sulphate mono(4-nitrophenyl) ester Sulphuric acid mono(4-nitrophenyl) ester mono (4-Nitrophenyl)-sulfate mono (4-Nitrophenyl)-sulphate |
sabiorkM:22922 | 4-Nitrophenyl sulfate p-Nitrophenyl sulfate |
biggM:4nphsf | 4-Nitrophenyl sulfate |
biggM:M_4nphsf hmdb:HMDB06492 seedM:M_cpd22596 | secondary/obsolete/fantasy identifier |
chebi:140994 | 4-nitrophenyl sulfate p-nitrophenyl sulfate |
metacycM:CPD-10183 seedM:cpd22596 | p-nitrophenyl sulfate |
MNXM10226 | is deprecated and replaced by this entry |
MNXM90334 | is deprecated and replaced by this entry |