Feedback

4-nitrophenyl hydrogen sulfate

PropertiesImageOccurences in reactions
MNX_IDMNXM2618Image of MNXM2618
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 3
formulaC6H4NO6S
charge-1
mass218.1651
referencechebi:35422
InChIKeyJBGHTSSFSSUKLR-UHFFFAOYSA-M
InChIInChI=1S/C6H5NO6S/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H,10,11,12)/p-1
SMILES[O-][N+](=O)c1ccc(OS([O-])(=O)=O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-176600
reactomeM:R-ALL-176600
CHEBI:35422
chebi:35422
4-nitrophenyl hydrogen sulfate
4-nitrophenyl sulfate
p-nitrophenol sulfate
p-nitrophenyl sulfate
para-nitrophenyl sulfate
sulfuric acid mono(4-nitrophenyl) ester
bigg.metabolite:4nphsf
biggM:4nphsf
4-Nitrophenyl sulfate
hmdb:HMDB0006492 4-Nitrophenyl sulfate
(4-nitrophenyl)oxidanesulfonic acid
4-Nitrophenyl
4-Nitrophenyl sulfate, ion (1-)
4-Nitrophenyl sulfate, potassium salt
4-Nitrophenyl sulfate, sodium salt
4-Nitrophenyl sulfuric acid
4-Nitrophenyl sulphate
4-Nitrophenyl sulphuric acid
P-Nitrophenol sulfate
P-Nitrophenol sulfuric acid
P-Nitrophenol sulphate
P-Nitrophenol sulphuric acid
P-Nitrophenyl sulfate
P-Nitrophenyl sulfuric acid
P-Nitrophenyl sulphate
P-Nitrophenyl sulphuric acid
P-nitro-Phenol
P-nitrophenyl sulfate
Para-nitrophenyl sulfate
Para-nitrophenyl sulfuric acid
Para-nitrophenyl sulphate
Para-nitrophenyl sulphuric acid
Sulfate mono(4-nitrophenyl) ester
Sulfuric acid mono(4-nitrophenyl) ester
Sulphate mono(4-nitrophenyl) ester
Sulphuric acid mono(4-nitrophenyl) ester
mono (4-Nitrophenyl)-sulfate
mono (4-Nitrophenyl)-sulphate
sabiork.compound:22922
sabiorkM:22922
4-Nitrophenyl sulfate
p-Nitrophenyl sulfate
CHEBI:140994
chebi:140994
4-nitrophenyl sulfate
p-nitrophenyl sulfate
metacyc.compound:CPD-10183
metacycM:CPD-10183
seed.compound:cpd22596
seedM:cpd22596
p-nitrophenyl sulfate
hmdb:HMDB06492
biggM:M_4nphsf
seedM:M_cpd22596
secondary/obsolete/fantasy identifier