Feedback

4-nitrophenyl hydrogen sulfate

Properties
MNX_IDMNXM2618
formulaC6H5NO6S
charge0
mass219.17304
referencechebi:35422
Image of MNXM2618
InChIKeyJBGHTSSFSSUKLR-UHFFFAOYSA-N
InChIInChI=1S/C6H5NO6S/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H,10,11,12)
SMILESOS(=O)(=O)Oc1ccc(cc1)[N+]([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:35422
reactome:R-ALL-176600
4-nitrophenyl hydrogen sulfate
4-nitrophenyl sulfate
p-nitrophenol sulfate
p-nitrophenyl sulfate
para-nitrophenyl sulfate
sulfuric acid mono(4-nitrophenyl) ester
hmdb:HMDB0006492 4-Nitrophenyl sulfate
(4-nitrophenyl)oxidanesulfonic acid
4-Nitrophenyl
4-Nitrophenyl sulfate, ion (1-)
4-Nitrophenyl sulfate, potassium salt
4-Nitrophenyl sulfate, sodium salt
4-Nitrophenyl sulfuric acid
4-Nitrophenyl sulphate
4-Nitrophenyl sulphuric acid
P-Nitrophenol sulfate
P-Nitrophenol sulfuric acid
P-Nitrophenol sulphate
P-Nitrophenol sulphuric acid
P-Nitrophenyl sulfate
P-Nitrophenyl sulfuric acid
P-Nitrophenyl sulphate
P-Nitrophenyl sulphuric acid
P-nitro-Phenol
P-nitrophenyl sulfate
Para-nitrophenyl sulfate
Para-nitrophenyl sulfuric acid
Para-nitrophenyl sulphate
Para-nitrophenyl sulphuric acid
Sulfate mono(4-nitrophenyl) ester
Sulfuric acid mono(4-nitrophenyl) ester
Sulphate mono(4-nitrophenyl) ester
Sulphuric acid mono(4-nitrophenyl) ester
mono (4-Nitrophenyl)-sulfate
mono (4-Nitrophenyl)-sulphate
sabiorkM:22922 4-Nitrophenyl sulfate
p-Nitrophenyl sulfate
biggM:4nphsf 4-Nitrophenyl sulfate
biggM:M_4nphsf
hmdb:HMDB06492
seedM:M_cpd22596
secondary/obsolete/fantasy identifier
chebi:140994 4-nitrophenyl sulfate
p-nitrophenyl sulfate
metacycM:CPD-10183
seedM:cpd22596
p-nitrophenyl sulfate
MNXM10226is deprecated and replaced by this entry
MNXM90334is deprecated and replaced by this entry