This is version 4.2 of MetaNetX/MNXref
 Feedback

2-oxoadipate

PropertiesImageOccurences in reactions
MNX_IDMNXM263Image of MNXM263
#reac
in my sandbox 0
in MNXref (generic)30
in models (compartimentalized) 16
formulaC6H6O5
charge-2
mass158.10884
referencechebi:57499
InChIKeyFGSBNBBHOZHUBO-UHFFFAOYSA-L
InChIInChI=1S/C6H8O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3H2,(H,8,9)(H,10,11)/p-2
SMILES[O-]C(=O)CCCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57499
chebi:57499
2-oxoadipate
2-oxoadipate(2-)
2-oxohexanedioate
bigg.metabolite:2oxoadp
biggM:2oxoadp
2 Oxoadipate
kegg.compound:C00322
keggC:C00322
2-Oxoadipate
2-Oxoadipic acid
sabiork.compound:2016
sabiorkM:2016
2-Oxoadipate
2-Oxoadipic acid
2-Oxoadipinate
seed.compound:cpd00269
seedM:cpd00269
2-Oxoadipate
2-Oxoadipic acid
2-keto-adipate
2-ketoadipate
2-oxoadipate
2-oxohexanedionic acid
2oxoadp
alpha-ketoadipate
metacyc.compound:2K-ADIPATE
metacycM:2K-ADIPATE
2-oxoadipate
2-keto-adipate
2-ketoadipate
2-oxohexanedionic acid
alpha-ketoadipate
reactome:R-ALL-113577
reactomeM:R-ALL-113577
reactome:R-ALL-70951
reactomeM:R-ALL-70951
CHEBI:15753
chebi:15753
2-oxoadipic acid
2-Oxoadipate
2-Oxoadipic acid
2-oxohexanedioic acid
hmdb:HMDB0000225 Oxoadipic acid
2-Ketoadipate
2-Ketoadipic acid
2-Oxoadipate
2-Oxoadipic acid
2-Oxohexanedioate
2-Oxohexanedioic acid
2-Oxohexanedionic acid
2-keto-Adipate
2-oxo-Hexanedioate
2-oxo-Hexanedioic acid
2-oxohexanedioic acid
Oxoadipate
a-Ketoadipate
a-Ketoadipic acid
a-Oxoadipate
a-Oxoadipic acid
alpha-Ketoadipate
alpha-Ketoadipic acid
alpha-Oxoadipate
alpha-Oxoadipic acid
oxoadipate
lipidmaps:LMFA01170121
lipidmapsM:LMFA01170121
Oxoadipic acid
2-oxo-hexanedioic acid
envipath:...aa63e03badec
envipathM:...aa63e03badec
compound 42297
hmdb:HMDB00225
chebi:11635
chebi:1247
chebi:19737
biggM:M_2oxoadp
keggC:M_C00322
seedM:M_cpd00269
secondary/obsolete/fantasy identifier