Feedback

D-arabinonate

Properties
MNX_IDMNXM2654
formulaC5H9O6
charge-1
mass165.12136
referencechebi:16157
Image of MNXM2654
InChIKeyQXKAIJAYHKCRRA-JJYYJPOSSA-M
InChIInChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3-,4+/m1/s1
SMILESOC[C@@H](O)[C@@H](O)[C@H](O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-1114 D-arabinonate
D-arabinonic acid
sabiorkM:2175 D-Arabinonate
chebi:16157 D-arabinonate
D-Arabinonate
keggC:C00878 D-Arabinonate
D-Arabinonic acid
seedM:cpd00651 D-Arabinonate
D-Arabinonic acid
D-arabinonate
D-arabinonic acid
D-arabonate
chebi:20912 D-arabinonic acid
D-Arabonic acid
hmdb:HMDB0000539 Arabinonic acid
(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid
Arabate
Arabic acid, sodium salt
Arabinonate
D-Arabonate
D-Arabonic acid
Sodium arabate
arabinonate
chebi:12913
chebi:20911
chebi:4101
chebi:58491
chebi:59450
hmdb:HMDB00539
keggC:M_C00878
seedM:M_cpd00651
secondary/obsolete/fantasy identifier