Feedback

D-arabinonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2654Image of MNXM2654
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC5H9O6
charge-1
mass165.12136
referencechebi:16157
InChIKeyQXKAIJAYHKCRRA-JJYYJPOSSA-M
InChIInChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3-,4+/m1/s1
SMILESOC[C@@H](O)[C@@H](O)[C@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16157
chebi:16157
D-arabinonate
D-Arabinonate
hmdb:HMDB0000539 Arabinonic acid
(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid
Arabate
Arabic acid, sodium salt
Arabinonate
D-Arabonate
D-Arabonic acid
Sodium arabate
arabinonate
sabiork.compound:2175
sabiorkM:2175
D-Arabinonate
kegg.compound:C00878
keggC:C00878
D-Arabinonate
D-Arabinonic acid
seed.compound:cpd00651
seedM:cpd00651
D-Arabinonate
D-Arabinonic acid
D-arabinonate
D-arabinonic acid
D-arabonate
metacyc.compound:CPD-1114
metacycM:CPD-1114
D-arabinonate
D-arabinonic acid
CHEBI:20912
chebi:20912
D-arabinonic acid
D-Arabonic acid
hmdb:HMDB00539
chebi:12913
chebi:20911
chebi:4101
chebi:58491
chebi:59450
keggC:M_C00878
seedM:M_cpd00651
secondary/obsolete/fantasy identifier