Feedback

dCMP

PropertiesImageOccurences in reactions
MNX_IDMNXM266Image of MNXM266
#reac
in my sandbox 0
in MNXref (generic)60
in models (compartimentalized) 47
formulaC9H12N3O7P
charge-2
mass305.181361
referencechebi:57566
InChIKeyNCMVOABPESMRCP-SHYZEUOFSA-L
InChIInChI=1S/C9H14N3O7P/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(19-8)4-18-20(15,16)17/h1-2,5-6,8,13H,3-4H2,(H2,10,11,14)(H2,15,16,17)/p-2/t5-,6+,8+/m0/s1
SMILESNc1ccn([C@H]2C[C@H](O)[C@@H](COP([O-])([O-])=O)O2)c(=O)n1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57566
chebi:57566
dCMP
2'-deoxy-5'-O-phosphonatocytidine
2'-deoxycytosine 5'-monophosphate(2-)
dCMP dianion
dCMP(2-)
reactome:R-ALL-109378
reactomeM:R-ALL-109378
reactome:R-ALL-109758
reactomeM:R-ALL-109758
CHEBI:15918
chebi:15918
2'-deoxycytosine 5'-monophosphate
2'-DEOXYCYTIDINE-5'-MONOPHOSPHATE
2'-Deoxycytidine 5'-monophosphate
2'-deoxy-5'-cytidylic acid
Deoxycytidine monophosphate
Deoxycytidylate
Deoxycytidylic acid
dCMP
bigg.metabolite:dcmp
biggM:dcmp
DCMP
hmdb:HMDB0001202 dCMP
2'-DEOXYCYTIDINE-5'-monophosphATE
2'-DEOXYCYTIDINE-5'-monophosphoric acid
2'-Deoxycytidine 5'-monophosphate
2'-Deoxycytidine 5'-monophosphoric acid
2'-Deoxycytidine-3'-monophosphate
2'-Deoxycytidine-5'-monophosphorate
2'-Deoxycytidine-5'-phosphate
2'-Deoxycytosine 5'-monophosphate
2'-Deoxycytosine 5'-monophosphoric acid
Acid, deoxycytidylic
Acids, deoxycytidylic
Deoxycytidine monophosphate
Deoxycytidine monophosphoric acid
Deoxycytidine-phosphate
Deoxycytidylate
Deoxycytidylic acid
Deoxycytidylic acids
Monophosphate, deoxycytidine
{[(2R,3S,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid
sabiork.compound:63
sabiorkM:63
dCMP
2'-Deoxycytidine 5'-monophosphate
2'-Deoxycytidine 5'-phosphate
Deoxycytidine monophosphate
Deoxycytidylate
Deoxycytidylic acid
seed.compound:cpd00206
seedM:cpd00206
dCMP
2'-Deoxycytidine 5'-monophosphate
2'-deoxycytidine 5'-monophosphate
2'-deoxycytidine 5'-phosphate
2'-deoxycytidine-5'-phosphate
Deoxycytidine monophosphate
Deoxycytidylate
Deoxycytidylic acid
dcmp
deoxycytidine monophosphate
deoxycytidine-phosphate
deoxycytidylate
deoxycytidylic acid
kegg.compound:C00239
keggC:C00239
dCMP
2'-Deoxycytidine 5'-monophosphate
Deoxycytidine monophosphate
Deoxycytidylate
Deoxycytidylic acid
metacyc.compound:DCMP
metacycM:DCMP
dCMP
2'-deoxycytidine 5'-monophosphate
2'-deoxycytidine 5'-phosphate
deoxycytidine monophosphate
deoxycytidine-phosphate
deoxycytidylate
deoxycytidylic acid
hmdb:HMDB01202
chebi:10493
chebi:14070
chebi:14071
chebi:14115
chebi:19242
chebi:41838
chebi:41875
biggM:M_dcmp
keggC:M_C00239
seedM:M_cpd00206
secondary/obsolete/fantasy identifier