Feedback

dopamine 3-O-sulfate

Properties
MNX_IDMNXM2668
formulaC8H11NO5S
charge0
mass233.24268
referencechebi:37946
Image of MNXM2668
InChIKeyNZKRYJGNYPYXJZ-UHFFFAOYSA-N
InChIInChI=1S/C8H11NO5S/c9-4-3-6-1-2-7(10)8(5-6)14-15(11,12)13/h1-2,5,10H,3-4,9H2,(H,11,12,13)
SMILESNCCc1ccc(O)c(OS(O)(=O)=O)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:133524 dopamine 3-O-sulfate zwitterion
5-(2-azaniumylethyl)-2-hydroxyphenyl sulfate
dopamine 3-monosulfate zwitterion
dopamine 3-sulfate zwitterion
chebi:37946
reactome:R-ALL-159352
dopamine 3-O-sulfate
4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
Dopamine 3-O-sulfate
Dopamine 3-sulfate
[5-(2-aminoethyl)-2-hydroxyphenyl]oxidanesulfonic acid
dopamine 3-monosulfate
keggC:C13690 Dopamine 3-O-sulfate
Dopamine 3-sulfate
seedM:cpd09522 Dopamine 3-O-sulfate
4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
Dopamine 3-sulfate
dopamine 3-O-sulfate
hmdb:HMDB0006275 Dopamine 3-O-sulfate
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulfuric acid)
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulphate)
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulphuric acid)
Dopamine 3-O-sulfuric acid
Dopamine 3-O-sulphate
Dopamine 3-O-sulphuric acid
Dopamine 3-sulfate
Dopamine 3-sulfuric acid
Dopamine 3-sulphate
Dopamine 3-sulphuric acid
[5-(2-aminoethyl)-2-hydroxyphenyl]oxidanesulfonic acid
dopamine 3-O-sulfate
biggM:M_dopasf
chebi:32705
chebi:34728
hmdb:HMDB06275
keggC:M_C13690
seedM:M_cpd09522
secondary/obsolete/fantasy identifier
metacycM:CPD-7649 dopamine 3-O-sulfate
4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
biggM:dopasf Dopamine 3-O-sulfate
MNXM163796is deprecated and replaced by this entry
MNXM90469is deprecated and replaced by this entry