Feedback

dopamine 3-O-sulfate

PropertiesImageOccurences in reactions
MNX_IDMNXM2668Image of MNXM2668
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 3
formulaC8H11NO5S
charge0
mass233.24268
referencechebi:37946
InChIKeyNZKRYJGNYPYXJZ-UHFFFAOYSA-N
InChIInChI=1S/C8H11NO5S/c9-4-3-6-1-2-7(10)8(5-6)14-15(11,12)13/h1-2,5,10H,3-4,9H2,(H,11,12,13)
SMILES[NH3+]CCc1ccc(O)c(OS([O-])(=O)=O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-159352
reactomeM:R-ALL-159352
CHEBI:37946
chebi:37946
dopamine 3-O-sulfate
4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
Dopamine 3-O-sulfate
Dopamine 3-sulfate
[5-(2-aminoethyl)-2-hydroxyphenyl]oxidanesulfonic acid
dopamine 3-monosulfate
bigg.metabolite:dopasf
biggM:dopasf
Dopamine 3-O-sulfate
hmdb:HMDB0006275 Dopamine 3-O-sulfate
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulfuric acid)
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulphate)
4-(2-Aminoethyl)-1,2-benzenediol 2-(hydrogen sulphuric acid)
Dopamine 3-O-sulfuric acid
Dopamine 3-O-sulphate
Dopamine 3-O-sulphuric acid
Dopamine 3-sulfate
Dopamine 3-sulfuric acid
Dopamine 3-sulphate
Dopamine 3-sulphuric acid
[5-(2-aminoethyl)-2-hydroxyphenyl]oxidanesulfonic acid
dopamine 3-O-sulfate
seed.compound:cpd09522
seedM:cpd09522
Dopamine 3-O-sulfate
4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
Dopamine 3-sulfate
dopamine 3-O-sulfate
kegg.compound:C13690
keggC:C13690
Dopamine 3-O-sulfate
Dopamine 3-sulfate
CHEBI:133524
chebi:133524
dopamine 3-O-sulfate zwitterion
5-(2-azaniumylethyl)-2-hydroxyphenyl sulfate
dopamine 3-monosulfate zwitterion
dopamine 3-sulfate zwitterion
metacyc.compound:CPD-7649
metacycM:CPD-7649
dopamine 3-O-sulfate
4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
hmdb:HMDB06275
chebi:32705
chebi:34728
biggM:M_dopasf
keggC:M_C13690
seedM:M_cpd09522
secondary/obsolete/fantasy identifier