This is version 4.2 of MetaNetX/MNXref
 Feedback

L-2-aminoadipate

PropertiesImageOccurences in reactions
MNX_IDMNXM268Image of MNXM268
#reac
in my sandbox 0
in MNXref (generic)36
in models (compartimentalized) 10
formulaC6H10NO4
charge-1
mass160.14794
referencechebi:58672
InChIKeyOYIFNHCXNCRBQI-BYPYZUCNSA-M
InChIInChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/p-1/t4-/m0/s1
SMILES[NH3+][C@@H](CCCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58672
chebi:58672
L-2-aminoadipate
(2S)-2-azaniumylhexanedioate
L-2-aminoadipate(1-)
bigg.metabolite:L2aadp
biggM:L2aadp
L 2 Aminoadipate
seed.compound:cpd00705
seedM:cpd00705
L-2-Aminoadipate
2-amino-hexanedioate
L-2-Aminoadipic acid
L-2-Aminohexanedioate
L-2-amino-hexanedioic acid
L-2-aminoadipate
L-2-aminoadipic acid
L-2-aminohexanedioate
L-alpha-Aminoadipate
L-alpha-Aminoadipic acid
L-alpha-aminoadipate
L-alpha-aminoadipic acid
L-aminoadipate
L-aminoadipic acid
L2aadp
hexanedioic acid, 2-amino-
sabiork.compound:5335
sabiorkM:5335
kegg.compound:C00956
keggC:C00956
L-2-Aminoadipate
L-2-Aminoadipic acid
L-2-Aminohexanedioate
L-alpha-Aminoadipate
L-alpha-Aminoadipic acid
reactome:R-ALL-508531
reactomeM:R-ALL-508531
CHEBI:17082
chebi:17082
L-2-aminoadipate(2-)
(2S)-2-aminohexanedioate
metacyc.compound:CPD-468
metacycM:CPD-468
L-2-aminoadipate
2-amino-hexanedioate
L-2-amino-hexanedioic acid
L-2-aminoadipic acid
L-2-aminohexanedioate
L-alpha-aminoadipate
L-alpha-aminoadipic acid
L-aminoadipate
L-aminoadipic acid
CHEBI:37023
chebi:37023
L-2-aminoadipic acid
(2S)-2-aminohexanedioic acid
(S)-2-aminohexanedioic acid
L-2-Aminoadipate
L-2-Aminoadipic acid
L-2-Aminohexanedioate
L-alpha-Aminoadipate
L-alpha-Aminoadipic acid
chebi:13051
chebi:13053
chebi:21200
chebi:21201
chebi:46332
chebi:6161
biggM:M_L2aadp
keggC:M_C00956
seedM:M_cpd00705
secondary/obsolete/fantasy identifier