Feedback

N-acetyl-4-O-acetylneuraminate

PropertiesImageOccurences in reactions
MNX_IDMNXM2699Image of MNXM2699
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC13H20NO10
charge-1
mass350.29864
referencechebi:29006
InChIKeyLVBIMVQYUKOENY-XAGGSGLKSA-M
InChIInChI=1S/C13H21NO10/c1-5(16)14-9-8(23-6(2)17)3-13(22,12(20)21)24-11(9)10(19)7(18)4-15/h7-11,15,18-19,22H,3-4H2,1-2H3,(H,14,16)(H,20,21)/p-1/t7-,8+,9-,10-,11-,13+/m1/s1
SMILESCC(=O)N[C@@H]1[C@H](C[C@](O)(O[C@H]1[C@H](O)[C@H](O)CO)C([O-])=O)OC(C)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29006
chebi:29006
N-acetyl-4-O-acetylneuraminate
5-acetamido-4-O-acetyl-3,5-dideoxy-D-glycero-beta-D-galacto-non-2-ulopyranosonate
N,4-O-Diacetylneuraminate
kegg.compound:C04015
keggC:C04015
N-Acetyl-4-O-acetylneuraminate
seed.compound:cpd02487
seedM:cpd02487
N-Acetyl-4-O-acetylneuraminate
N,4-O-Diacetylneuraminate
N-acetyl-4-O-acetylneuraminate
hmdb:HMDB0000796 N-Acetyl-4-O-acetylneuraminic acid
(2S,4S,5R,6R)-4-(acetyloxy)-5-acetamido-2-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid
4-Acetate 5-(acetylamino)-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonate
4-Acetate 5-(acetylamino)-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid
4-Acetate 5-acetamido-3,5-dideoxy-D-glycero-D-galacto-nonulosonate
4-Acetate 5-acetamido-3,5-dideoxy-D-glycero-D-galacto-nonulosonic acid
4-O-Acetyl-N-acetylneuraminate
4-O-Acetyl-N-acetylneuraminic acid
N,4-O-Diacetylneuraminate
N,4-O-Diacetylneuraminic acid
N-Acetyl-4-O-acetylneuraminate
Neu4,5ac2
metacyc.compound:CPD-414
metacycM:CPD-414
N-acetyl-4-O-acetylneuraminate
CHEBI:32844
chebi:32844
N-acetyl-4-O-acetylneuraminic acid
4-O-acetyl-N-acetylneuraminic acid
5-acetamido-4-O-acetyl-3,5-dideoxy-D-glycero-beta-D-galacto-non-2-ulopyranosonic acid
hmdb:HMDB00796
chebi:12440
chebi:21495
chebi:21496
chebi:58646
chebi:59449
chebi:7106
keggC:M_C04015
seedM:M_cpd02487
secondary/obsolete/fantasy identifier