Feedback

S-(hydroxymethyl)mycothiol

PropertiesImageOccurences in reactions
MNX_IDMNXM2726Image of MNXM2726
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC18H32N2O13S
charge0
mass516.51836
referencechebi:61586
InChIKeyQHDGYCVBKYWETJ-QFVXKRNMSA-N
InChIInChI=1S/C18H32N2O13S/c1-5(23)19-6(3-34-4-22)17(31)20-8-10(25)9(24)7(2-21)32-18(8)33-16-14(29)12(27)11(26)13(28)15(16)30/h6-16,18,21-22,24-30H,2-4H2,1H3,(H,19,23)(H,20,31)/t6-,7+,8+,9+,10+,11-,12-,13+,14+,15+,16-,18+/m0/s1
SMILESCC(=O)N[C@@H](CSCO)C(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:61586
chebi:61586
S-(hydroxymethyl)mycothiol
(1S,2R,3R,4S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl 2-{[N-acetyl-S-(hydroxymethyl)-L-cysteinyl]amino}-2-deoxy-alpha-D-glucopyranoside
1-O-(2-{[N-acetyl-S-(hydroxymethyl)-L-cysteinyl]amino}-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
kegg.compound:C18235
keggC:C18235
S-(Hydroxymethyl)mycothiol
seed.compound:cpd19501
seedM:cpd19501
S-(Hydroxymethyl)mycothiol
S-(hydroxymethyl)mycothiol
S-hydroxymethylmycothiol
metacyc.compound:S-HYDROXYMETHYLMYCOTHIOL
metacycM:S-HYDROXYMETHYLMYCOTHIOL
S-(hydroxymethyl)mycothiol
keggC:M_C18235
seedM:M_cpd19501
secondary/obsolete/fantasy identifier