Feedback

soyasapogenol B 3-O-beta-D-glucuronate

Properties
MNX_IDMNXM2728
formulaC36H57O9
charge-1
mass633.83238
referencechebi:62441
Image of MNXM2728
InChIKeyNARQRJFIZNOSJV-JIHAXZPOSA-M
InChIInChI=1S/C36H58O9/c1-31(2)16-20-19-8-9-22-33(4)12-11-24(44-30-27(41)25(39)26(40)28(45-30)29(42)43)34(5,18-37)21(33)10-13-36(22,7)35(19,6)15-14-32(20,3)23(38)17-31/h8,20-28,30,37-41H,9-18H2,1-7H3,(H,42,43)/p-1/t20-,21+,22+,23+,24-,25-,26-,27+,28-,30+,32+,33-,34+,35+,36+/m0/s1
SMILESCC1(C)C[C@@H](O)[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@@H]([C@@H](O)[C@H](O)[C@H]6O)C([O-])=O)[C@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2C1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:M_C19763
seedM:M_cpd21009
seedM:M_cpd24802
secondary/obsolete/fantasy identifier
chebi:62441 soyasapogenol B 3-O-beta-D-glucuronate
(3beta,22beta)-22,24-dihydroxyolean-12-en-3-yl beta-D-glucopyranosiduronate
soyasapogenol B 3-O-beta-glucuronate
soyasapogenol B 3-O-beta-glucuronide(1-)
chebi:62439 soyasapogenol B 3-O-beta-glucuronide
soyasapogenol B monoglucuronide
soyasapogenol B-3-O-beta-glucuronide
soyasapogenol B-3-O-glucuronide
keggC:C19763
seedM:cpd21009
Soyasapogenol B 3-O-D-glucuronide
Soyasapogenol B 3-O-beta-D-glucuronide
metacycM:CPD-7612
seedM:cpd24802
soyasapogenol B-3-O-beta-glucuronide