Feedback

terephthalate

PropertiesImageOccurences in reactions
MNX_IDMNXM2734Image of MNXM2734
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC8H4O4
charge-2
mass164.01206
referencechebi:30043
InChIKeyKKEYFWRCBNTPAC-UHFFFAOYSA-L
InChIInChI=1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2
SMILESO=C([O-])c1ccc(C(=O)[O-])cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30043
chebi:30043
terephthalate
1,4-benzenedicarboxylate
1,4-benzenedicarboxylic acid, ion(2-)
benzene-1,4-dicarboxylate
terephthalate(2-)
envipath:...76efe66b1be1
envipathM:...76efe66b1be1
Terephthalate
seed.compound:cpd03778
seedM:cpd03778
Terephthalate
1,4-Benzenedicarboxylic acid
1,4-bezenedicarboxylic acid
1,4-dicarboxybenzene
Terephthalic acid
p-phthalic acid
terephthalate
terephthalic acid
sabiork.compound:8555
sabiorkM:8555
Terephthalate
1,4-Benzenedicarboxylic acid
Benzene 1,4-dicarboxylate
Terephthalic acid
kegg.compound:C06337
keggC:C06337
Terephthalate
1,4-Benzenedicarboxylic acid
Terephthalic acid
hmdb:HMDB0002428 Terephthalic acid
1,4-Benzenedicarboxylate
1,4-Benzenedicarboxylic acid
Benzene-p-dicarboxylate
Benzene-p-dicarboxylic acid
Disodium terephthalate
Kyselina terftalova
Para-benzenedicarboxylate
Para-benzenedicarboxylic acid
TPA
Terephthalate
benzene-1,4-dicarboxylic acid
p-Benzenedicarboxylate
p-Benzenedicarboxylic acid
p-Dicarboxybenzene
p-Phthalate
p-Phthalic acid
p-Phthelate
p-Phthelic acid
terephthalic acid
CHEBI:30801
chebi:30801
terephthalate(1-)
4-carboxybenzoate
hydrogen terephthalate
metacyc.compound:TEREPHTHALATE
metacycM:TEREPHTHALATE
terephthalate
1,4-bezenedicarboxylic acid
1,4-dicarboxybenzene
TPA
p-phthalic acid
terephthalic acid
envipath:...bec2875118c7
envipathM:...bec2875118c7
terephthalic acid
CHEBI:15702
chebi:15702
terephthalic acid
1,4-Benzenedicarboxylic acid
TPA
Terephthalic acid
benzene-1,4-dicarboxylic acid
p-benzenedicarboxylic acid
para-benzenedicarboxylic acid
hmdb:HMDB0061917
hmdb:HMDB02428
hmdb:HMDB61917
chebi:15211
chebi:26868
chebi:26870
chebi:9452
keggC:M_C06337
seedM:M_cpd03778
secondary/obsolete/fantasy identifier