Feedback

terephthalate

Properties
MNX_IDMNXM2734
formulaC8H4O4
charge-2
mass164.11496
referencechebi:30043
Image of MNXM2734
InChIKeyKKEYFWRCBNTPAC-UHFFFAOYSA-L
InChIInChI=1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)c1ccc(cc1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:TEREPHTHALATE terephthalate
1,4-bezenedicarboxylic acid
1,4-dicarboxybenzene
TPA
p-phthalic acid
terephthalic acid
keggC:C06337 Terephthalate
1,4-Benzenedicarboxylic acid
Terephthalic acid
hmdb:HMDB0061917 Terephthalate
1,4-Benzenedicarboxylate
1,4-Benzenedicarboxylic acid
Benzene-P-dicarboxylate
Benzene-P-dicarboxylic acid
Disodium terephthalate
Kyselina terftalova
P-Benzenedicarboxylate
P-Benzenedicarboxylic acid
P-Dicarboxybenzene
P-Phthalate
P-Phthalic acid
P-Phthelate
P-Phthelic acid
Para-benzenedicarboxylate
Para-benzenedicarboxylic acid
TPA
benzene-1,4-dicarboxylic acid
terephthalic acid
seedM:cpd03778 Terephthalate
1,4-Benzenedicarboxylic acid
1,4-bezenedicarboxylic acid
1,4-dicarboxybenzene
Terephthalic acid
p-phthalic acid
terephthalate
terephthalic acid
envipath:...76efe66b1be1 Terephthalate
chebi:15702 terephthalic acid
1,4-Benzenedicarboxylic acid
TPA
Terephthalic acid
benzene-1,4-dicarboxylic acid
p-benzenedicarboxylic acid
para-benzenedicarboxylic acid
chebi:15211
chebi:26868
chebi:26870
chebi:9452
hmdb:HMDB02428
hmdb:HMDB61917
keggC:M_C06337
seedM:M_cpd03778
secondary/obsolete/fantasy identifier
chebi:30043 terephthalate
1,4-benzenedicarboxylate
1,4-benzenedicarboxylic acid, ion(2-)
benzene-1,4-dicarboxylate
terephthalate(2-)
chebi:30801 terephthalate(1-)
4-carboxybenzoate
hydrogen terephthalate
hmdb:HMDB0002428 Terephthalic acid
1,4-Benzenedicarboxylate
1,4-Benzenedicarboxylic acid
Benzene-P-dicarboxylate
Benzene-P-dicarboxylic acid
Disodium terephthalate
Kyselina terftalova
P-Benzenedicarboxylate
P-Benzenedicarboxylic acid
P-Dicarboxybenzene
P-Phthalate
P-Phthalic acid
P-Phthelate
P-Phthelic acid
Para-benzenedicarboxylate
Para-benzenedicarboxylic acid
TPA
Terephthalate
benzene-1,4-dicarboxylic acid
terephthalic acid
sabiorkM:8555 Terephthalate
1,4-Benzenedicarboxylic acid
Benzene 1,4-dicarboxylate
Terephthalic acid
envipath:...bec2875118c7 terephthalic acid