This is version 4.2 of MetaNetX/MNXref
 Feedback

(2R)-2-phosphoglycerate

PropertiesImageOccurences in reactions
MNX_IDMNXM275Image of MNXM275
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 14
formulaC3H4O7P
charge-3
mass183.033421
referencechebi:58289
InChIKeyGXIURPTVHJPJLF-UWTATZPHSA-K
InChIInChI=1S/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9)/p-3/t2-/m1/s1
SMILESOC[C@@H](OP([O-])([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-30485
reactomeM:R-ALL-30485
CHEBI:58289
chebi:58289
(2R)-2-phosphoglycerate
(2R)-3-hydroxy-2-(phosphonatooxy)propanoate
2-phosphonato-D-glycerate
2-phosphonato-D-glycerate trianion
2-phosphonato-D-glycerate(3-)
seed.compound:cpd00482
seedM:cpd00482
2-Phospho-D-glycerate
2-P-D-glycerate
2-Phospho-(R)-glycerate
2-phospho-(D)-glycerate
2-phospho-(R)-glycerate
2-phospho-D-glycerate
2-phospho-D-glyceric acid
2pg
D-2-phosphoglycerate
D-Glycerate 2-phosphate
D-Glycerate2-phosphate
kegg.compound:C00631
keggC:C00631
2-Phospho-D-glycerate
2-Phospho-(R)-glycerate
D-Glycerate 2-phosphate
sabiork.compound:31
sabiorkM:31
2-Phospho-D-glycerate
D-Glycerate 2-phosphate
hmdb:HMDB0003391 2-Phospho-D-glyceric acid
(+-)-2-phosphoglycerate
(2R)-3-Hydroxy-2-(phosphonooxy)propanoate
(2R)-3-Hydroxy-2-(phosphonooxy)propanoic acid
(2R)-3-hydroxy-2-(phosphonooxy)propanoic acid
2-PHOSPHOGLYCERIC ACID
2-PHOSPHOGLYCERate
2-phospho-D-Glycerate
3-D-Hydroxy-2-phosphonooxy-propanoate
3-D-Hydroxy-2-phosphonooxy-propanoic acid
D-Glycerate 2-phosphate
D-Glyceric acid 2-phosphoric acid
sabiork.compound:30192
sabiorkM:30192
2-Phosphoglycerate
2-Phosphoglyceric acid
2PG
G2P
Glycerate 2-phosphate
hmdb:HMDB0000362 2-Phosphoglyceric acid
2-(Dihydrogen phosphate)glycerate
2-(Dihydrogen phosphate)glyceric acid
2-P-D-Glycerate
2-P-D-Glyceric acid
2-P-Glycerate
2-P-Glyceric acid
2-Phosphoglycerate
2-Phosphoglycerate, (+-)-isomer
2-Phosphoglycerate, (R)-isomer
2-Phosphoglycerate, (S)-isomer
2-Phosphoglycerate, monosodium salt
2-phospho-D-Glycerate
2-phospho-DL-Glyceric acid
2-phosphoglyceric acid
3-Hydroxy-2-(phosphonooxy)propanoate
3-Hydroxy-2-(phosphonooxy)propanoic acid
3-Hydroxy-2-phosphonooxypropanoate
3-Hydroxy-2-phosphonooxypropanoic acid
3-hydroxy-2-(phosphonooxy)propanoic acid
DL-2-Phosphoglycerate
Glycerate 2-phosphate
Glyceric acid 2-phosphate
Phosphoglycerate
metacyc.compound:2-PG
metacycM:2-PG
2-phospho-D-glycerate
2-P-D-glycerate
2-phospho-(D)-glycerate
2-phospho-(R)-glycerate
2-phospho-D-glyceric acid
D-2-phosphoglycerate
D-Glycerate 2-phosphate
CHEBI:17835
chebi:17835
2-phospho-D-glyceric acid
(2R)-3-hydroxy-2-(phosphonooxy)propanoic acid
2-PHOSPHOGLYCERIC ACID
2-Phospho-D-glycerate
2-phospho-D-glycerate
D-Glycerate 2-phosphate
D-glycerate 2-phosphate
CHEBI:88350
chebi:88350
2-phosphoglycerate(3-)
2-phosphonatoglycerate(3-)
3-hydroxy-2-(phosphonatooxy)propanoate
CHEBI:24344
chebi:24344
2-phosphoglyceric acid
3-hydroxy-2-(phosphonooxy)propanoic acid
hmdb:HMDB0062707 2-phosphonato-D-glycerate(3-)
2-(Dihydrogen phosphate)glycerate
2-(Dihydrogen phosphate)glyceric acid
2-P-D-Glycerate
2-P-D-Glyceric acid
2-P-Glycerate
2-P-Glyceric acid
2-Phosphoglycerate
2-Phosphoglycerate, (+-)-isomer
2-Phosphoglycerate, (R)-isomer
2-Phosphoglycerate, (S)-isomer
2-Phosphoglycerate, monosodium salt
2-phospho-D-Glycerate
2-phospho-DL-Glyceric acid
2-phosphoglyceric acid
3-Hydroxy-2-(phosphonooxy)propanoate
3-Hydroxy-2-(phosphonooxy)propanoic acid
3-Hydroxy-2-phosphonooxypropanoate
3-Hydroxy-2-phosphonooxypropanoic acid
3-hydroxy-2-(phosphonooxy)propanoic acid
DL-2-Phosphoglycerate
Glycerate 2-phosphate
Glyceric acid 2-phosphate
Phosphoglycerate
bigg.metabolite:2pg
biggM:2pg
D-Glycerate 2-phosphate
hmdb:HMDB00362
hmdb:HMDB03391
hmdb:HMDB62707
chebi:11651
chebi:1267
chebi:12986
chebi:21028
chebi:39868
biggM:M_2pg
keggC:M_C00631
seedM:M_cpd00482
secondary/obsolete/fantasy identifier