Feedback

(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate

Properties
MNX_IDMNXM2750
formulaC6H7O6
charge-1
mass175.11618
referencechebi:57442
Image of MNXM2750
InChIKeyIMUGYKFHMJLTOU-WVZVXSGGSA-M
InChIInChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h2-3,5,8,10H,1H2,(H,11,12)/p-1/t3-,5+/m0/s1
SMILESO[C@@H](CC(=O)C([O-])=O)[C@H](O)C=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
lipidmaps:LMFA01050449 (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
4-deoxy-L-erythro-hex-5-ulosuronic acid
FA(6:0(OH2,Ke))
chebi:57442 (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
(4S,5S)-4,5-dihydroxy-2,6-diketohexanoate
4-deoxy-L-erythro-hex-5-ulosuronate
chebi:15624 (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
(4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
4-deoxy-L-erythro-hex-5-ulosuronic acid
keggC:C04471 (4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate
metacycM:4S5S-45-DIHYDROXY-26-DIOXOHEXANOATE (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
4,5-dihydroxy-2,6-dioxo-hexanoic acid
4-deoxy-L-erythro-5-hexoseulose uronate
seedM:cpd02728 (4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
4,5-dihydroxy-2,6-dioxo-hexanoic acid
4-deoxy-L-erythro-5-hexoseulose uronate
chebi:10902
chebi:18581
chebi:231
keggC:M_C04471
seedM:M_cpd02728
secondary/obsolete/fantasy identifier