Feedback

(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2750Image of MNXM2750
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC6H7O6
charge-1
mass175.11618
referencechebi:57442
InChIKeyIMUGYKFHMJLTOU-WVZVXSGGSA-M
InChIInChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h2-3,5,8,10H,1H2,(H,11,12)/p-1/t3-,5+/m0/s1
SMILESO[C@@H](CC(=O)C([O-])=O)[C@H](O)C=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57442
chebi:57442
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
(4S,5S)-4,5-dihydroxy-2,6-diketohexanoate
4-deoxy-L-erythro-hex-5-ulosuronate
kegg.compound:C04471
keggC:C04471
(4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate
seed.compound:cpd02728
seedM:cpd02728
(4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
4,5-dihydroxy-2,6-dioxo-hexanoic acid
4-deoxy-L-erythro-5-hexoseulose uronate
metacyc.compound:4S5S-45-DIHYDROXY-26-DIOXOHEXANOATE
metacycM:4S5S-45-DIHYDROXY-26-DIOXOHEXANOATE
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
4,5-dihydroxy-2,6-dioxo-hexanoic acid
4-deoxy-L-erythro-5-hexoseulose uronate
CHEBI:15624
chebi:15624
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
(4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate
4-deoxy-L-erythro-hex-5-ulosuronic acid
lipidmaps:LMFA01050449
lipidmapsM:LMFA01050449
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
4-deoxy-L-erythro-hex-5-ulosuronic acid
FA(6:0(OH2,Ke))
chebi:10902
chebi:18581
chebi:231
keggC:M_C04471
seedM:M_cpd02728
secondary/obsolete/fantasy identifier