Feedback

(7R)-7-(5-carboxy-5-oxopentanamido)deacetylcephalosporanate

Properties
MNX_IDMNXM2752
formulaC16H16N2O9S
charge-2
mass412.37232
referencechebi:57536
Image of MNXM2752
InChIKeyUKRMDFPJXIVYCZ-BXUZGUMPSA-L
InChIInChI=1S/C16H18N2O9S/c1-7(19)27-5-8-6-28-14-11(13(22)18(14)12(8)16(25)26)17-10(21)4-2-3-9(20)15(23)24/h11,14H,2-6H2,1H3,(H,17,21)(H,23,24)(H,25,26)/p-2/t11-,14-/m1/s1
SMILESCC(=O)OCC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCC(=O)C([O-])=O)C2=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd02869 7-(5-Carboxyl-5-oxopentanyl)aminocephalosporinate
(7R)-7-(5-Carboxy-5-oxopentanoyl)aminocephalosporinate
(7R)-7-(5-carboxy-5-oxopentanamido)cephalosporanate
(7R)-7-(5-carboxy-5-oxopentanamido)deacetylcephalosporanate
(7R)-7-(5-carboxy-5-oxopentanoyl)aminocephalosporinate
7-(5-carboxyl-5-oxopentanyl)-aminocephalosporinate
metacycM:7-5-CARBOXYL-5-OXOPENTANYL-AMINOCEPHAL (7R)-7-(5-carboxy-5-oxopentanamido)cephalosporanate
(7R)-7-(5-carboxy-5-oxopentanamido)deacetylcephalosporanate
chebi:15838 (7R)-7-(5-carboxy-5-oxopentanamido)cephalosporanic acid
(6R,7R)-3-(acetoxymethyl)-7-[(5-carboxy-5-oxopentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
(7R)-7-(5-Carboxy-5-oxopentanoyl)aminocephalosporinate
(7R)-7-(5-carboxy-5-oxopentanoyl)aminocephalosporinic acid
7-(5-Carboxyl-5-oxopentanyl)-aminocephalosporinate
chebi:57536 (7R)-7-(5-carboxy-5-oxopentanamido)deacetylcephalosporanate
(6R,7R)-3-(acetoxymethyl)-7-[(5-carboxylato-5-oxopentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
(7R)-7-(5-carboxy-5-oxopentanamido)cephalosporanate(2-)
(7R)-7-(5-carboxylato-5-oxopentanamido)cephalosporanate dianion
hmdb:HMDB0060316 (7R)-7-(5-Carboxy-5-oxopentanoyl)aminocephalosporinate
(6R,7R)-3-[(acetyloxy)methyl]-7-[(5-carboxy-1-hydroxy-5-oxopentylidene)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
(7R)-7-(5-Carboxy-5-oxopentanamido)cephalosporanate
(7R)-7-(5-Carboxy-5-oxopentanoyl)aminocephalosporinic acid
7-(5-Carboxyl-5-oxopentanyl)-aminocephalosporinate
7-(5-Carboxyl-5-oxopentanyl)-aminocephalosporinic acid
keggC:C04712 (7R)-7-(5-Carboxy-5-oxopentanoyl)aminocephalosporinate
chebi:12248
chebi:20773
chebi:2254
hmdb:HMDB60316
keggC:M_C04712
seedM:M_cpd02869
secondary/obsolete/fantasy identifier
sabiorkM:7508 7-(5-Carboxyl-5-oxopentanyl)-aminocephalosporinate