Feedback

4-methylsulfanyl-2-oxobutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM276Image of MNXM276
#reac
in my sandbox 0
in MNXref (generic)51
in models (compartimentalized) 26
formulaC5H7O3S
charge-1
mass147.01214
referencechebi:16723
InChIKeySXFSQZDSUWACKX-UHFFFAOYSA-M
InChIInChI=1S/C5H8O3S/c1-9-3-2-4(6)5(7)8/h2-3H2,1H3,(H,7,8)/p-1
SMILESCSCCC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-1237122
reactomeM:R-ALL-1237122
CHEBI:16723
chebi:16723
4-methylsulfanyl-2-oxobutanoate
2-oxo-4-methylthiobutanoate
4-(methylsulfanyl)-2-oxobutanoate
4-methylthio-2-oxobutanoate
hmdb:HMDB0001553 2-Oxo-4-methylthiobutanoic acid
2-Keto-4-methylthiobutanoic acid
2-Keto-4-methylthiobutyrate
2-Keto-4-methylthiobutyric acid
2-Keto-4-methylthiobutyric acid, calcium salt
2-Keto-4-methylthiobutyric acid, monosodium salt
2-Keto-4-thiomethylbutyrate
2-Ketomethiobutyrate
2-Ketothiomethylbutyric acid
2-Oxomethionine
2-oxo-4-Methylthiobutanoate
2-oxo-4-Methylthiobutanoic acid
2-oxo-4-Thiomethylbutyric acid
2-oxo-4-thiomethylbutyric acid
4-(METHYLsulfanyl)-2-oxobutanoIC ACID
4-(METHYLsulphanyl)-2-oxobutanoate
4-(METHYLsulphanyl)-2-oxobutanoic acid
4-(Methylsulfanyl)-2-oxobutanoate
4-(methylsulfanyl)-2-oxobutanoic acid
4-Methylmercapto-2-oxobutyrate
4-Methylthio-2-ketobutanoate
4-Methylthio-2-ketobutanoic acid
4-Methylthio-2-ketobutyrate
4-Methylthio-2-ketobutyric acid
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
4-Methylthio-2-oxobutyrate
4-Methylthio-2-oxobutyric acid
KMTB
Keto-4-methylthiobutyrate
Ketomethiobutyrate
Ketomethiobutyric acid
Methylthiobutyrate
Methylthiobutyric acid
S-Methyl-alpha-ketobutyric acid
a-oxo-g-Methylthiobutyrate
a-oxo-g-Methylthiobutyric acid
alpha-Keto-gamma-methiolbutyrate
alpha-Keto-methiolbutyric acid
alpha-Ketomethionine
alpha-Oxomethionine
alpha-oxo-gamma-Methylthiobutyrate
alpha-oxo-gamma-Methylthiobutyric acid
alpha-oxo-gamma-methylthiobutyrate
alpha-oxo-gamma-methylthiobutyric acid
gamma-Methiol-keto-butyric acid
bigg.metabolite:2kmb
biggM:2kmb
2-keto-4-methylthiobutyrate
lipidmaps:LMFA01060170
lipidmapsM:LMFA01060170
2-oxo-4-methylthio-butanoic acid
2-oxo-4-methylthio-butanoic acid
4-Methylthio-2-oxobutanoic acid
metacyc.compound:CPD-479
metacycM:CPD-479
4-(methylsulfanyl)-2-oxobutanoate
2-keto-4-methylthiobutanoate
2-keto-4-methylthiobutyrate
2-keto-4-methylthiobutyric acid
2-keto-methyl-thio-butyrate
2-ketomethiobutyrate
2-oxo-4-methylthiobutanoic acid
2-oxomethionine
4-(methylthio)-2-oxobutanoate
4-methylthio-2-ketobutanoate
4-methylthio-2-ketobutyrate
4-methylthio-2-oxobutanoate
4-methylthio-2-oxobutyrate
KMTB
alpha-keto-4-methylthiobutyrate
alpha-keto-gamma-methylthiobutyrate
alpha-keto-gamma-methylthiobutyric acid
alpha-ketomethiobutyrate
alpha-ketomethiobutyric acid
ketomethiobutyrate
bigg.metabolite:4mtob
biggM:4mtob
4-Methyl-Thio-Oxo-Butyrate
bigg.metabolite:4met2obut
biggM:4met2obut
4-Methylthio-2-oxobutanoate
sabiork.compound:5424
sabiorkM:5424
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
4-Methylthio-2-oxobutyrate
kegg.compound:C01180
keggC:C01180
4-Methylthio-2-oxobutanoic acid
2-Keto-4-methylthiobutyric acid
2-Oxo-4-methylthiobutanoate
2-Oxo-4-methylthiobutanoic acid
4-(Methylsulfanyl)-2-oxobutanoate
4-Methylthio-2-oxobutanoate
seed.compound:cpd00869
seedM:cpd00869
4-methylthio 2-oxobutyrate
2-Keto-4-methylthiobutyric acid
2-Oxo-4-methylthiobutanoate
2-Oxo-4-methylthiobutanoic acid
2-keto-4-methylthiobutanoate
2-keto-4-methylthiobutyrate
2-keto-4-methylthiobutyric acid
2-keto-methyl-thio-butyrate
2-ketomethiobutyrate
2-oxo-4-methylthiobutanoate
2-oxo-4-methylthiobutanoic acid
2-oxomethionine
2kmb
4-(methylsulfanyl)-2-oxobutanoate
4-(methylthio)-2-oxobutanoate
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
4-methylthio-2-ketobutanoate
4-methylthio-2-ketobutyrate
4-methylthio-2-oxobutanoate
4-methylthio-2-oxobutyrate
KMTB
alpha-keto-4-methylthiobutyrate
alpha-keto-gamma-methylthiobutyrate
alpha-keto-gamma-methylthiobutyric acid
alpha-ketomethiobutyrate
alpha-ketomethiobutyric acid
CHEBI:33574
chebi:33574
4-methylthio-2-oxobutanoic acid
2-Keto-4-methylthiobutyric acid
2-Oxo-4-methylthiobutanoate
2-keto-4-methylthiobutyric acid
2-oxomethionine
4-(METHYLSULFANYL)-2-OXOBUTANOIC ACID
4-(methylsulfanyl)-2-oxobutanoic acid
4-Methylthio-2-oxobutanoate
4-Methylthio-2-oxobutanoic acid
alpha-oxo-gamma-methylthiobutyric acid
hmdb:HMDB0013210
hmdb:HMDB01553
hmdb:HMDB13210
chebi:12029
chebi:1902
chebi:20451
chebi:22458
chebi:43720
chebi:63388
biggM:M_2kmb
biggM:M_4met2obut
biggM:M_4mtob
keggC:M_C01180
seedM:M_cpd00869
secondary/obsolete/fantasy identifier