Feedback

1,3,7-trimethylurate

PropertiesImageOccurences in reactions
MNX_IDMNXM2761Image of MNXM2761
#reac
in my sandbox 0
in MNXref (generic)18
in models (compartimentalized) 1
formulaC8H10N4O3
charge0
mass210.07529
referencechebi:691622
InChIKeyBYXCFUMGEBZDDI-UHFFFAOYSA-N
InChIInChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h1-3H3,(H,9,14)
SMILESCn1c(=O)c2c([nH]c(=O)n2C)n(C)c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:691622
chebi:691622
1,3,7-trimethylurate
1,3,7-trimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione
1,3,7-trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione
1,3,7-trimethyluric acid
7,9-dihydro-1,3,7-trimethyl-1H-purine-2,6,8(3H)-trione
8-oxocaffeine
8-oxy-caffeine
envipath:...09807889c5ea
envipathM:...09807889c5ea
1,3,7-Trimethyluric acid
hmdb:HMDB0002123 1,3,7-Trimethyluric acid
1,3, 7-Trimethyluric acid
1,3,7-Trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione
1,3,7-Trimethylate
1,3,7-Trimethylic acid
1,3,7-Trimethylurate
1,3,7-trimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione
1,3,7-trimethyluric acid
2,6,8-Trihydroxy-1,3,7-trimethylpurine
7,9-Dihydro-1,3,7-trimethyl-1H-purine-2,6,8(3H)-trione
8-Hydroxy-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
8-Oxy-caffeine
Trimethyl uric acid
kegg.compound:C16361
keggC:C16361
1,3,7-Trimethyluric acid
1,3,7-Trimethylurate
seed.compound:cpd15077
seedM:cpd15077
1,3,7-Trimethyluric acid
1,3,7-Trimethylurate
1,3,7-trimethylurate
1,3,7-trimethyluric acid
CHEBI:132940
chebi:132940
1,3,7-trimethylurate
1,3,7-trimethylurate anion
1,3,7-trimethyluric acid anion
metacyc.compound:CPD-12480
metacycM:CPD-12480
1,3,7-trimethylurate
1,3,7-trimethyluric acid
hmdb:HMDB02123
keggC:M_C16361
seedM:M_cpd15077
secondary/obsolete/fantasy identifier