Feedback

(12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2765Image of MNXM2765
#reac
in my sandbox 0
in MNXref (generic)14
in models (compartimentalized) 32
formulaC20H31O4
charge-1
mass335.22278
referencechebi:57444
InChIKeyZIOZYRSDNLNNNJ-LQWMCKPYSA-M
InChIInChI=1S/C20H32O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h7-11,13-14,17,19,23H,2-6,12,15-16,18H2,1H3,(H,21,22)/p-1/b9-7-,11-8-,13-10-,17-14+/t19-/m0/s1
SMILESCCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)[O-])OO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57444
chebi:57444
(12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
12(S)-HPETE anion
12(S)-HPETE(1-)
metacyc.compound:5Z8Z10E14Z-12S-12-HYDROPEROXYICOS
metacycM:5Z8Z10E14Z-12S-12-HYDROPEROXYICOS
(12S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
SLM:000000961
slm:000000961
(12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate
(12S)-Hp-(5Z,8Z,10E,14Z)-ETE
(12S)-HpETE
seed.compound:cpd03554
seedM:cpd03554
12(S)-HPETE
(12S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
hmdb:HMDB0004243 12(S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,12S,14Z)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12-HPETE, (S-(e,Z,Z,Z))-isomer
12-HPETE, (S-(e,e,e))-isomer
12-HPETE, (e,Z,Z,Z)-isomer
12-HpETE
12-Hydroperoxy-5,8,10,14-icosatetraenoic acid
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
12-L-Hydroperoxy-5,8,10,14-eicosatetraenoic acid
12-Oohete
Arachidonate omega-9 hydroperoxide
Arachidonic acid omega-9 hydroperoxide
Omega-9 hpaa
Omega-9-hydroperoxyarachidonate
Omega-9-hydroperoxyarachidonic acid
reactome:R-ALL-2142811
reactomeM:R-ALL-2142811
CHEBI:15626
chebi:15626
12(S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12-HpETE
12-Hpete
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
12-Oohete
Arachidonic acid omega-9 hydroperoxide
omega-9 Hpaa
omega-9-Hydroperoxyarachidonic acid
kegg.compound:C05965
keggC:C05965
12(S)-HPETE
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
sabiork.compound:8307
sabiorkM:8307
12-HPETE
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12(S)-HPETE
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
bigg.metabolite:12HPET
biggM:12HPET
12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
lipidmaps:LMFA03060013
lipidmapsM:LMFA03060013
12S-HpETE
12S-hydroperoxy-5Z,8Z,10E,14Z-eicosatetraenoic acid
FA 20:4
O2
hmdb:HMDB04243
chebi:10907
chebi:18593
chebi:19137
chebi:250
chebi:740
biggM:M_12HPET
keggC:M_C05965
seedM:M_cpd03554
secondary/obsolete/fantasy identifier