Feedback

(12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate

Properties
MNX_IDMNXM2765
formulaC20H31O4
charge-1
mass335.45774
referencechebi:57444
Image of MNXM2765
InChIKeyZIOZYRSDNLNNNJ-LQWMCKPYSA-M
InChIInChI=1S/C20H32O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h7-11,13-14,17,19,23H,2-6,12,15-16,18H2,1H3,(H,21,22)/p-1/b9-7-,11-8-,13-10-,17-14+/t19-/m0/s1
SMILESCCCCC\C=C/C[C@H](OO)\C=C\C=C/C\C=C/CCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref14
Distinct compatimentalized reactions in models12

Similar chemical compounds in external resources
IdentifierDescription
keggC:C05965 12(S)-HPETE
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
biggM:M_12HPET
chebi:10907
chebi:18593
chebi:19137
chebi:250
chebi:740
hmdb:HMDB04243
keggC:M_C05965
seedM:M_cpd03554
secondary/obsolete/fantasy identifier
metacycM:5Z8Z10E14Z-12S-12-HYDROPEROXYICOS (12S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
seedM:cpd03554 12(S)-HPETE
(12S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
slm:000000961 (12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate
(12S)-Hp-(5Z,8Z,10E,14Z)-ETE
(12S)-HpETE
lipidmaps:LMFA03060013 12S-HpETE
12S-hydroperoxy-5Z,8Z,10E,14Z-eicosatetraenoic acid
hmdb:HMDB0004243 12(S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,12S,14Z)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12-HPETE, (S-(e,Z,Z,Z))-isomer
12-HPETE, (S-(e,e,e))-isomer
12-HPETE, (e,Z,Z,Z)-isomer
12-HpETE
12-Hydroperoxy-5,8,10,14-icosatetraenoic acid
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
12-L-Hydroperoxy-5,8,10,14-eicosatetraenoic acid
12-Oohete
Arachidonate omega-9 hydroperoxide
Arachidonic acid omega-9 hydroperoxide
Omega-9 hpaa
Omega-9-hydroperoxyarachidonate
Omega-9-hydroperoxyarachidonic acid
chebi:57444 (12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate
12(S)-HPETE anion
12(S)-HPETE(1-)
chebi:15626
reactome:R-ALL-2142811
12(S)-HPETE
(5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoic acid
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoate
(5Z,8Z,10E,14Z)-(12S)-12-Hydroperoxyicosa-5,8,10,14-tetraenoic acid
12-HpETE
12-Hpete
12-Hydroperoxyeicosatetraenoate
12-Hydroperoxyeicosatetraenoic acid
12-Hydroperoxyicosatetraenoate
12-Hydroperoxyicosatetraenoic acid
12-Oohete
Arachidonic acid omega-9 hydroperoxide
omega-9 Hpaa
omega-9-Hydroperoxyarachidonic acid
biggM:12HPET 12-Hydroperoxyeicosa-5,8,10,14-tetraenoate
MNXM13989is deprecated and replaced by this entry