Feedback

2,3-dihydroxybenzenesulfonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2772Image of MNXM2772
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC6H5O5S
charge-1
mass188.98632
referencechebi:33565
InChIKeyVZYDKJOUEPFKMW-UHFFFAOYSA-M
InChIInChI=1S/C6H6O5S/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3,7-8H,(H,9,10,11)/p-1
SMILESO=S(=O)([O-])c1cccc(O)c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:33565
chebi:33565
2,3-dihydroxybenzenesulfonate
3-sulfocatechol
CHEBI:27802
chebi:27802
2,3-dihydroxybenzenesulfonic acid
2,3-Dihydroxybenzenesulfonate
3-Sulfocatechol
envipath:...8ddd833e92aa
envipathM:...8ddd833e92aa
3-Sulfocatechol
kegg.compound:C06336
keggC:C06336
3-Sulfocatechol
2,3-Dihydroxybenzenesulfonate
seed.compound:cpd03777
seedM:cpd03777
3-Sulfocatechol
2,3-Dihydroxybenzenesulfonate
2,3-dihydroxybenzenesulfonate
3-sulfocatechol
3SC
metacyc.compound:3-SULFOCATECHOL
metacycM:3-SULFOCATECHOL
3-sulfocatechol
2,3-dihydroxybenzenesulfonate
3SC
chebi:11426
chebi:1666
chebi:20201
keggC:M_C06336
seedM:M_cpd03777
secondary/obsolete/fantasy identifier