Feedback

2,3-dihydroxybenzenesulfonate

Properties
MNX_IDMNXM2772
formulaC6H5O5S
charge-1
mass189.1669
referencechebi:33565
Image of MNXM2772
InChIKeyVZYDKJOUEPFKMW-UHFFFAOYSA-M
InChIInChI=1S/C6H6O5S/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3,7-8H,(H,9,10,11)/p-1
SMILESOc1cccc(c1O)S([O-])(=O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:11426
chebi:1666
chebi:20201
keggC:M_C06336
seedM:M_cpd03777
secondary/obsolete/fantasy identifier
chebi:33565 2,3-dihydroxybenzenesulfonate
3-sulfocatechol
envipath:...8ddd833e92aa 3-Sulfocatechol
chebi:27802 2,3-dihydroxybenzenesulfonic acid
2,3-Dihydroxybenzenesulfonate
3-Sulfocatechol
seedM:cpd03777 3-Sulfocatechol
2,3-Dihydroxybenzenesulfonate
2,3-dihydroxybenzenesulfonate
3-sulfocatechol
3SC
keggC:C06336 3-Sulfocatechol
2,3-Dihydroxybenzenesulfonate
metacycM:3-SULFOCATECHOL 3-sulfocatechol
2,3-dihydroxybenzenesulfonate
3SC