Feedback

2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2775Image of MNXM2775
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC7H13NO5
charge0
mass191.18186
referencechebi:58859
InChIKeyIFMHGOADXGYWMO-KVQBGUIXSA-N
InChIInChI=1S/C7H13NO5/c1-3(9)6(11)5(10)2-4(8)7(12)13/h4-6,10-11H,2,8H2,1H3,(H,12,13)/t4-,5+,6+/m0/s1
SMILESCC(=O)[C@@H](O)[C@H](O)C[C@H]([NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58859
chebi:58859
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonate
(2S,4R,5S)-2-ammonio-4,5-dihydroxy-6-oxoheptanoate
(2S,4R,5S)-2-azaniumyl-4,5-dihydroxy-6-oxoheptanoate
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid zwitterion
2-azaniumyl-2,3,7-trideoxy-D-lyxo-hept-6-ulosonate
kegg.compound:C16850
keggC:C16850
2-Amino-3,7-dideoxy-D-threo-hept-6-ulosonic acid
seed.compound:cpd17159
seedM:cpd17159
2-Amino-3,7-dideoxy-D-threo-hept-6-ulosonic acid
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid
2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate
ADTH
CHEBI:51282
chebi:51282
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid
2-Amino-3,7-dideoxy-D-threo-hept-6-ulosonic acid
lipidmaps:LMFA01050473
lipidmapsM:LMFA01050473
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid
2-Amino-3,7-dideoxy-D-threo-hept-6-ulosonic acid
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid
metacyc.compound:CPD-10792
metacycM:CPD-10792
2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate
2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid
ADTH
keggC:M_C16850
seedM:M_cpd17159
secondary/obsolete/fantasy identifier