Feedback

3,4-dihydrocoumarin

Properties
MNX_IDMNXM2778
formulaC9H8O2
charge0
mass148.15862
referencechebi:16151
Image of MNXM2778
InChIKeyVMUXSMXIQBNMGZ-UHFFFAOYSA-N
InChIInChI=1S/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2
SMILESO=C1CCc2ccccc2O1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:C02274 Dihydrocoumarin
3,4-Dihydrocoumarin
chebi:16151 3,4-dihydrocoumarin
1,2-benzodihydropyrone
2-chromanone
2-hydroxydihydrocinnamic acid lactone
3,4-Dihydrocoumarin
3,4-dihydro-2H-1-benzopyran-2-one
3,4-dihydro-2H-chromen-2-one
Dihydrocoumarin
benzodihydropyrone
chroman-2-one
hydrocoumarin
melilotic acid lactone
melilotic lactone
melilotin
melilotol
o-hydroxydihydrocinnamic acid lactone
o-hydroxyhydrocinnamic acid delta-lactone
oxochroman
envipath:...99cef1f8e06f 3,4-Dihydrocoumarin
hmdb:HMDB0036626 3,4-Dihydro-2H-1-benzopyran-2-one
1,2-Benzodihydropyrone
2-Hydroxydihydrocinnamate lactone
2-Hydroxydihydrocinnamic acid lactone
2-Hydroxyhydrocinnamic lactone
3,4-Dihydrocoumarin
3,4-Dihydroxycoumarin
3,4-dihydro-1-Benzopyran-2-one
3,4-dihydro-2H-1-benzopyran-2-one
3,4-dihydro-2H-Chromen-2-one
3,4-dihydro-Coumarin
Benzodihydropyrone
FEMA 2381
Hydrocinnamic acid, O-hydroxy-, delta-lactone
Hydrocoumarin
Hydrocoumarin, 8ci
Melilotate lactone
Melilotic acid lactone
Melilotic lactone
Melilotin
Melilotin (coumarin)
Melilotin??
Melilotol
O-Hydroxydihydrocinnamate lactone
O-Hydroxydihydrocinnamic acid lactone
O-Hydroxyhydrocinnamate delta-lactone
O-Hydroxyhydrocinnamic acid delta-lactone
O-Hydroxyhydrocinnamic acid lactone
dihydro-Benzopyranone
dihydrocoumarin
seedM:cpd01533 Dihydrocoumarin
1,2-benzodihydropyrone
2-chromanone
2H-1-benzopyran-2-one, 3,4-dihydro-
3,4-Dihydrocoumarin
3,4-dihydrocoumarin
dihydrocoumarin
hydrocinnamic acid, o-hydroxy-,lactone
hydrocoumarin
melilotic lactone
melilotin
melilotol
meliotine
metacycM:DIHYDROCOUMARIN 3,4-dihydrocoumarin
1,2-benzodihydropyrone
2-chromanone
2-hydroxydihydrocinnamic acid lactone
3,4-dihydro-2H-1-benzopyran-2-one
hydrocoumarin
melilotic lactone
melilotin
melilotol
meliotine
o-hydroxydihydrocinnamic acid lactone
chebi:14147
chebi:23737
chebi:4560
hmdb:HMDB36626
keggC:M_C02274
seedM:M_cpd01533
secondary/obsolete/fantasy identifier