Feedback

3,4-dihydroxybenzaldehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM2779Image of MNXM2779
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 2
formulaC7H6O3
charge0
mass138.12074
referencechebi:50205
InChIKeyIBGBGRVKPALMCQ-UHFFFAOYSA-N
InChIInChI=1S/C7H6O3/c8-4-5-1-2-6(9)7(10)3-5/h1-4,9-10H
SMILESOc1ccc(C=O)cc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:50205
chebi:50205
3,4-dihydroxybenzaldehyde
1,2-dihydroxy-4-formylbenzene
3,4-dihydroxybenzenecarbonal
4-formyl-1,2-benzenediol
4-formyl-1,2-dihydroxybenzene
Protocatechualdehyde
protocatechualdehyde
protocatechuic aldehyde
hmdb:HMDB0059965 3,4-Dihydroxybenzaldehyde
1,2-Dihydroxy-4-formylbenzene
3,4-Dihydroxybenzenecarbonal
3,4-dihydroxybenzaldehyde
4-Formyl-1,2-benzenediol
4-Formyl-1,2-dihydroxybenzene
Protocatechualdehyde
Protocatechuic aldehyde
kegg.compound:C16700
keggC:C16700
3,4-Dihydroxybenzaldehyde
Protocatechualdehyde
bigg.metabolite:34dhbald
biggM:34dhbald
3,4-dihydroxybenzaldehyde
metacyc.compound:CPD-7616
metacycM:CPD-7616
3,4-dihydroxybenzaldehyde
3,4-dihydroxybenzyl aldehyde
protocatechualdehyde
protocatechuic aldehyde
rancinamycin IV
sabiork.compound:23378
sabiorkM:23378
4-Formylcatechol
seed.compound:cpd16507
seedM:cpd16507
Protocatechualdehyde
3,4-Dihydroxybenzaldehyde
3,4-dihydroxybenzaldehyde
3,4-dihydroxybenzyl aldehyde
34dhbald
protocatechualdehyde
protocatechuic aldehyde
rancinamycin IV
envipath:...3a66412fa9b9
envipathM:...3a66412fa9b9
compound 40367
hmdb:HMDB59965
biggM:M_34dhbald
keggC:M_C16700
seedM:M_cpd16507
secondary/obsolete/fantasy identifier