Feedback

(2R)-3-(3,4-dihydroxyphenyl)lactate

Properties
MNX_IDMNXM2781
formulaC9H9O5
charge-1
mass197.16476
referencechebi:71492
Image of MNXM2781
InChIKeyPAFLSMZLRSPALU-MRVPVSSYSA-M
InChIInChI=1S/C9H10O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8,10-12H,4H2,(H,13,14)/p-1/t8-/m1/s1
SMILESO[C@H](Cc1ccc(O)c(O)c1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:71492 (2R)-3-(3,4-dihydroxyphenyl)lactate
(2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate
seedM:cpd00887 3-(3,4-Dihydroxyphenyl)lactate
3,4-Dihydroxyphenyllactic acid
3-(3,4-dihydroxyphenyl)-2-hydroxy-propanoic acid
3-(3,4-dihydroxyphenyl)lactate
chebi:71572 (2R)-3-(3,4-dihydroxyphenyl)lactic acid
(2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid
seedM:cpd24677 R(+)-3,4-dihydroxyphenyllactate
(2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate
(R)-3-(3,4-dihydroxyphenyl)lactate
R(+)-(3,4-dihydroxyphenyl)lactic acid
R(+)-3,4-dihydroxyphenyllactic acid
keggC:C01207 3-(3,4-Dihydroxyphenyl)lactate
3,4-Dihydroxyphenyllactic acid
metacycM:CPD-6982 (R)-3-(3,4-dihydroxyphenyl)lactate
(2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate
R(+)-(3,4-dihydroxyphenyl)lactic acid
hmdb:HMDB0003503 3-(3,4-Dihydroxyphenyl)lactic acid
(3,4-Dihydroxyphenyl)lactic acid
2-Hydroxy-3-(3,4-dihydroxyphenyl)propanoate
2-Hydroxy-3-(3,4-dihydroxyphenyl)propanoic acid
3,4-Dihydroxyphenyllactic acid
3,4-Dihydroxyphenyllactic acid, (+-)-isomer
3,4-Dihydroxyphenyllactic acid, (R)-isomer
3,4-Dihydroxyphenyllactic acid, monosodium salt
3,4-Dihydroxyphenyllactic acid, monosodium salt, (+-)-isomer
3,4-Dihydroxyphenyllactic acid, monosodium salt, (R)-isomer
3-(3,4-Dihydroxyphenyl)lactate
3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid
DL-b-(3,4-Dihydroxyphenyl)lactic acid
DL-beta-(3,4-Dihydroxyphenyl)lactic acid
Danshensu
Salvianic acid a sodium
a-Hydroxyhydrocaffeic acid
alpha-Hydroxyhydrocaffeate
alpha-Hydroxyhydrocaffeic acid
danshensu
chebi:58279 3-(3,4-dihydroxyphenyl)lactate
3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate
3-(3,4-dihydroxyphenyl)lactate anion
3-(3,4-dihydroxyphenyl)lactate(1-)
chebi:11720
chebi:1423
chebi:19925
hmdb:HMDB03503
keggC:M_C01207
keggC:M_C22038
seedM:M_cpd00887
seedM:M_cpd24677
secondary/obsolete/fantasy identifier
metacycM:3-34-DIHYDROXYPHENYLLACTATE 3-(3,4-dihydroxyphenyl)lactate
3-(3,4-dihydroxyphenyl)-2-hydroxy-propanoic acid
chebi:17807 3-(3,4-dihydroxyphenyl)lactic acid
3-(3,4-Dihydroxyphenyl)lactate
3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid
keggC:C22038 (R)-3-(3,4-Dihydroxyphenyl)lactate
MNXM162900is deprecated and replaced by this entry