Feedback

3,4-dihydroxy-5-all-trans-hexaprenylbenzoate

Properties
MNX_IDMNXM2783
formulaC37H53O4
charge-1
mass561.81432
referencechebi:58373
Image of MNXM2783
InChIKeyVEPICJBQCOUQPI-IRVXXIIISA-M
InChIInChI=1S/C37H54O4/c1-27(2)13-8-14-28(3)15-9-16-29(4)17-10-18-30(5)19-11-20-31(6)21-12-22-32(7)23-24-33-25-34(37(40)41)26-35(38)36(33)39/h13,15,17,19,21,23,25-26,38-39H,8-12,14,16,18,20,22,24H2,1-7H3,(H,40,41)/p-1/b28-15+,29-17+,30-19+,31-21+,32-23+
SMILESCC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\Cc1cc(cc(O)c1O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref13
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0001063 3-Hexaprenyl-4,5-Dihydroxybenzoic acid
3,4-Dihydroxy-5-hexaprenylbenzoate
3,4-Dihydroxy-5-hexaprenylbenzoic acid
3-Hexaprenyl-4,5-dihydroxybenzoate
3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoic acid
Dhhpba
dhhpba
seedM:cpd03092 3-Hexaprenyl-4,5-dihydroxybenzoate
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
3-hexaprenyl-4,5-dihydroxybenzoate
3dh5hpb
lipidmaps:LMPR02010043 LMPR02010043
3-Hexaprenyl-4,5-dihydroxybenzoic acid
keggC:C05200 3-Hexaprenyl-4,5-dihydroxybenzoate
chebi:18081
reactome:R-ALL-2162278
3-hexaprenyl-4,5-dihydroxybenzoic acid
3-Hexaprenyl-4,5-dihydroxybenzoate
3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoic acid
metacycM:CPD-21768 3-all trans-hexaprenyl-4,5-dihydroxybenzoate
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
3-hexaprenyl-4,5-dihydroxybenzoate
3-hexaprenyl-4-,5-dihydroxybenzoic acid
biggM:M_3dh5hpb
chebi:11798
chebi:1509
chebi:20027
hmdb:HMDB01063
keggC:M_C05200
seedM:M_cpd03092
secondary/obsolete/fantasy identifier
chebi:58373 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoate
3-hexaprenyl-4,5-dihydroxybenzoate
3-hexaprenyl-4,5-dihydroxybenzoate anion
3-hexaprenyl-4,5-dihydroxybenzoate(1-)
biggM:3dh5hpb 3 Hexaprenyl 4 5 dihydroxybenzoate
MNXM114669is deprecated and replaced by this entry