Feedback

3,4-dihydroxy-5-all-trans-hexaprenylbenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2783Image of MNXM2783
#reac
in my sandbox 0
in MNXref (generic)14
in models (compartimentalized) 4
formulaC37H53O4
charge-1
mass561.81432
referencechebi:58373
InChIKeyVEPICJBQCOUQPI-IRVXXIIISA-M
InChIInChI=1S/C37H54O4/c1-27(2)13-8-14-28(3)15-9-16-29(4)17-10-18-30(5)19-11-20-31(6)21-12-22-32(7)23-24-33-25-34(37(40)41)26-35(38)36(33)39/h13,15,17,19,21,23,25-26,38-39H,8-12,14,16,18,20,22,24H2,1-7H3,(H,40,41)/p-1/b28-15+,29-17+,30-19+,31-21+,32-23+
SMILESCC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\Cc1cc(cc(O)c1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58373
chebi:58373
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoate
3-hexaprenyl-4,5-dihydroxybenzoate
3-hexaprenyl-4,5-dihydroxybenzoate anion
3-hexaprenyl-4,5-dihydroxybenzoate(1-)
bigg.metabolite:3dh5hpb
biggM:3dh5hpb
3 Hexaprenyl 4 5 dihydroxybenzoate
hmdb:HMDB0001063 3-Hexaprenyl-4,5-Dihydroxybenzoic acid
3,4-Dihydroxy-5-hexaprenylbenzoate
3,4-Dihydroxy-5-hexaprenylbenzoic acid
3-Hexaprenyl-4,5-dihydroxybenzoate
3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoic acid
Dhhpba
dhhpba
kegg.compound:C05200
keggC:C05200
3-Hexaprenyl-4,5-dihydroxybenzoate
seed.compound:cpd03092
seedM:cpd03092
3-Hexaprenyl-4,5-dihydroxybenzoate
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
3-hexaprenyl-4,5-dihydroxybenzoate
3dh5hpb
metacyc.compound:CPD-21768
metacycM:CPD-21768
3-all trans-hexaprenyl-4,5-dihydroxybenzoate
3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
3-hexaprenyl-4,5-dihydroxybenzoate
3-hexaprenyl-4-,5-dihydroxybenzoic acid
reactome:R-ALL-2162278
reactomeM:R-ALL-2162278
CHEBI:18081
chebi:18081
3-hexaprenyl-4,5-dihydroxybenzoic acid
3-Hexaprenyl-4,5-dihydroxybenzoate
3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoic acid
lipidmaps:LMPR02010043
lipidmapsM:LMPR02010043
LMPR02010043
3-Hexaprenyl-4,5-dihydroxybenzoic acid
hmdb:HMDB01063
chebi:11798
chebi:1509
chebi:20027
biggM:M_3dh5hpb
keggC:M_C05200
seedM:M_cpd03092
secondary/obsolete/fantasy identifier