Feedback

2-(5-methylsulfanyl)oxopentanoate

Properties
MNX_IDMNXM2791
formulaC6H9O3S
charge-1
mass161.19986
referencechebi:58815
Image of MNXM2791
InChIKeyMPJMAJLPWRBNBU-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3S/c1-10-4-2-3-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1
SMILESCSCCCC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:58815 2-(5-methylsulfanyl)oxopentanoate
5-(methylsulfanyl)-2-oxopentanoate
5-methylthio-2-oxopentanoate
metacycM:2-OXO-5-METHYLTHIOPENTANOIC-ACID 5-(methylsulfanyl)-2-oxopentanoate
5-(methylthio)-2-oxopentanoate
5-(methylthio)-2-oxopentanoic-acid
keggC:M_C17211
seedM:M_cpd17401
secondary/obsolete/fantasy identifier
chebi:50260 5-methylthio-2-oxopentanoic acid
2-Oxo-5-methylthiopentanoic acid
5-(Methylthio)-2-oxo-pentanoic acid
5-(methylsulfanyl)-2-oxopentanoic acid
seedM:cpd17401 2-Oxo-5-methylthiopentanoic acid
2-oxo-5-methylthiopentanoate
2-oxo-5-methylthiopentanoic-acid
5-(Methylthio)-2-oxo-pentanoic acid
5-(methylsulfanyl)-2-oxopentanoate
5-(methylthio)-2-oxopentanoate
5-(methylthio)-2-oxopentanoic-acid
5-methylthio-2-oxopentanoate
keggC:C17211 2-Oxo-5-methylthiopentanoic acid
5-(Methylthio)-2-oxo-pentanoic acid