Feedback

2-(5-methylsulfanyl)oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2791Image of MNXM2791
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 0
formulaC6H9O3S
charge-1
mass161.19986
referencechebi:58815
InChIKeyMPJMAJLPWRBNBU-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3S/c1-10-4-2-3-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1
SMILESCSCCCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58815
chebi:58815
2-(5-methylsulfanyl)oxopentanoate
5-(methylsulfanyl)-2-oxopentanoate
5-methylthio-2-oxopentanoate
seed.compound:cpd17401
seedM:cpd17401
2-Oxo-5-methylthiopentanoic acid
2-oxo-5-methylthiopentanoate
2-oxo-5-methylthiopentanoic-acid
5-(Methylthio)-2-oxo-pentanoic acid
5-(methylsulfanyl)-2-oxopentanoate
5-(methylthio)-2-oxopentanoate
5-(methylthio)-2-oxopentanoic-acid
5-methylthio-2-oxopentanoate
kegg.compound:C17211
keggC:C17211
2-Oxo-5-methylthiopentanoic acid
5-(Methylthio)-2-oxo-pentanoic acid
metacyc.compound:2-OXO-5-METHYLTHIOPENTANOIC-ACID
metacycM:2-OXO-5-METHYLTHIOPENTANOIC-ACID
5-(methylsulfanyl)-2-oxopentanoate
5-(methylthio)-2-oxopentanoate
5-(methylthio)-2-oxopentanoic-acid
CHEBI:50260
chebi:50260
5-methylthio-2-oxopentanoic acid
2-Oxo-5-methylthiopentanoic acid
5-(Methylthio)-2-oxo-pentanoic acid
5-(methylsulfanyl)-2-oxopentanoic acid
keggC:M_C17211
seedM:M_cpd17401
secondary/obsolete/fantasy identifier