Feedback

hexanedioate

PropertiesImageOccurences in reactions
MNX_IDMNXM2800Image of MNXM2800
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 10
formulaC6H8O4
charge-2
mass144.04336
referencechebi:17128
InChIKeyWNLRTRBMVRJNCN-UHFFFAOYSA-L
InChIInChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)/p-2
SMILESO=C([O-])CCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17128
chebi:17128
hexanedioate
O2C(CH2)4CO2 dianion
adipate dianion
adipate(2-)
hexan-1,6-dicarboxylate
hexanedioic acid, ion(2-)
envipath:...03317c15c763
envipathM:...03317c15c763
Adipate
sabiork.compound:2863
sabiorkM:2863
Adipate
1,6-Hexanedicarboxylic acid
Adipic acid
Hexan-1,6-dicarboxylate
Hexanedioate
seed.compound:cpd03642
seedM:cpd03642
Adipate
ADIPATE
Adipic acid
Hexan-1,6-dicarboxylate
Hexanedioate
adipate
adipic acid
hexanedioic acid
kegg.compound:C06104
keggC:C06104
Adipate
Adipic acid
Hexan-1,6-dicarboxylate
Hexanedioate
kegg.drug:D08839
keggD:D08839
Adipic acid (NF)
hmdb:HMDB0000448 Adipic acid
1,4-Butanedicarboxylate
1,4-Butanedicarboxylic acid
1,6-Hexanedioate
1,6-Hexanedioic acid
Acifloctin
Acinetten
Adi-pure
Adilactetten
Adipate
Adipic acid, MG salt (1:1)
Adipic acid, calcium salt
Adipic acid, cu salt
Adipic acid, cu(+2) salt
Adipic acid, cu(+2) salt (1:1)
Adipic acid, diammonium salt
Adipic acid, disodium salt
Adipic acid, monoammonium salt
Adipic acid, nickel salt
Adipic acid, potassium salt
Adipic acid, sodium salt
Adipinate
Adipinic acid
Adipinsaeure
Ammonium adipate
Diammonium adipate
Hexan-1,6-dicarboxylate
Hexan-1,6-dicarboxylic acid
Hexanedioate
Hexanedioic acid
INS no. 355
Kyselina adipova
Magnesium adipate
Molten adipate
Molten adipic acid
Sodium adipate
adipic acid
e 355
e-355
e355
hexanedioic acid
lipidmaps:LMFA01170048
lipidmapsM:LMFA01170048
Adipic acid
FA 6:1
Hexanedioic acid
O2
bigg.metabolite:adpac
biggM:adpac
Adipic acid
hexane-1,6-dioic acid
SLM:000000720
slm:000000720
Hexanedioate
CHEBI:30833
chebi:30833
adipate(1-)
5-carboxypentanoate
hexanedioic acid, conjugate base
hydrogen adipate
metacyc.compound:ADIPATE
metacycM:ADIPATE
adipate
adipic acid
hexanedioic acid
CHEBI:30832
chebi:30832
adipic acid
1,4-butanedicarboxylic acid
1,6-hexanedioic acid
Adipic acid
Adipinsaeure
E 355
E-355
E355
INS No. 355
adipinic acid
hexanedioic acid
envipath:...489cf87c9e69
envipathM:...489cf87c9e69
compound 42086
hmdb:HMDB0004862
hmdb:HMDB00448
hmdb:HMDB04862
chebi:13744
chebi:22264
chebi:22268
chebi:2489
biggM:M_adpac
keggC:M_C06104
keggD:M_D08839
seedM:M_cpd03642
secondary/obsolete/fantasy identifier