Feedback

7,8-dihydrofolate

PropertiesImageOccurences in reactions
MNX_IDMNXM281Image of MNXM281
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 27
formulaC19H19N7O6
charge-2
mass441.14078
referencechebi:57451
InChIKeyOZRNSSUDZOLUSN-LBPRGKRZSA-L
InChIInChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t12-/m0/s1
SMILESNc1nc2c(c(=O)[nH]1)N=C(CNc1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1)CN2
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57451
chebi:57451
7,8-dihydrofolate
N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamate
dihydrofolate dianion
dihydrofolate(2-)
bigg.metabolite:dhf
biggM:dhf
7,8-Dihydrofolate
metacyc.compound:DIHYDROFOLATE
metacycM:DIHYDROFOLATE
7,8-dihydrofolate monoglutamate
7,8-dihydrofolate
7,8-dihydropteroyl monoglutamate
7,8-dihydropteroylglutamate
7,8-pteroylglutamate
7,8-pteroylglutamic acid
H2PteGlu
H2PteGlu1
dihydrofolate
seed.compound:cpd00330
seedM:cpd00330
Dihydrofolate
7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
7,8-dihydrofolate
7,8-dihydrofolate monoglutamate
7,8-dihydropteroyl monoglutamate
7,8-dihydropteroylglutamate
7-8-Dihydrofolate
DHF
Dihydrofolic acid
FH2
H2PteGlu
H2PteGlu1
dhf
dihydrofolate
kegg.compound:C00415
keggC:C00415
Dihydrofolate
7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
Dihydrofolic acid
sabiork.compound:1336
sabiorkM:1336
Dihydrofolate
7,8-Dihydrofolate
7,8-Dihydrofolic acid
Dihydrofolic acid
H2PteGlu1
hmdb:HMDB0001056 Dihydrofolic acid
(2S)-2-[(4-{[(2-amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
7,8-Dihydro-L-folic acid
7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
7,8-Dihydropteroylglutamic acid
Dihydrofolate
Dihydrofolate, (D)-isomer
H2PteGlu
H2PteGlu1
L-N-[p-[[(2-Amino-7,8-dihydro-4-hydroxy-6-pteridinyl)methyl]amino]benzoyl]-glutamic acid
N-(4-(((2-Amino-1,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl)amino)benzoyl)-L-glutamic acid
N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
N-(7,8-Dihydropteroyl)-L-glutamate
N-(7,8-Dihydropteroyl)-L-glutamic acid
N-[4-[[(2-Amino-1,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-glutamic acid
N-[4-[[(2-Amino-3,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-glutamic acid
Vitamin b9
dihydrofolic acid
reactome:R-ALL-73604
reactomeM:R-ALL-73604
CHEBI:15633
chebi:15633
dihydrofolic acid
7,8-Dihydrofolate
7,8-Dihydrofolic acid
7,8-Dihydropteroylglutamate
Dihydrofolate
Dihydrofolic acid
N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
N-(7,8-dihydropteroyl)-L-glutamic acid
hmdb:HMDB01056
chebi:12245
chebi:14150
chebi:20768
chebi:42000
chebi:4564
biggM:M_dhf
keggC:M_C00415
seedM:M_cpd00330
secondary/obsolete/fantasy identifier