Feedback

taurine

PropertiesImageOccurences in reactions
MNX_IDMNXM282Image of MNXM282
#reac
in my sandbox 0
in MNXref (generic)59
in models (compartimentalized) 33
formulaC2H7NO3S
charge0
mass125.14792
referencechebi:507393
InChIKeyXOAAWQZATWQOTB-UHFFFAOYSA-N
InChIInChI=1S/C2H7NO3S/c3-1-2-7(4,5)6/h1-3H2,(H,4,5,6)
SMILES[NH3+]CCS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:507393
chebi:507393
taurine
2-ammonioethanesulfonate
2-azaniumylethane-1-sulfonate
taurine zwitterion
CHEBI:32970
chebi:32970
2-aminoethanesulfonate
bigg.metabolite:taur
biggM:taur
Taurine
kegg.drug:D00047
keggD:D00047
Taurine (JP17/USP/INN)
Aminoethylsulfonic acid (JAN)
Taurine (TN)
hmdb:HMDB0000251 Taurine
1-Aminoethane-2-sulfonate
1-Aminoethane-2-sulfonic acid
2-Aminoethanesulfonate
2-Aminoethanesulfonic acid
2-Aminoethanesulphonate
2-Aminoethanesulphonic acid
2-Aminoethyl sulfonate
2-Aminoethyl sulfonic acid
2-Aminoethyl sulphonate
2-Aminoethyl sulphonic acid
2-Aminoethylsulfonate
2-Aminoethylsulfonic acid
2-Sulfoethylamine
2-aminoethane-1-sulfonic acid
Aminoethylsulfonate
Aminoethylsulfonic acid
Aminoethylsulphonate
Aminoethylsulphonic acid
Taufon
Tauphon
Taurine hydrochloride
Taurine zinc salt (2:1)
Taurine, monopotassium salt
b-Aminoethylsulfonate
b-Aminoethylsulfonic acid
b-Aminoethylsulphonate
b-Aminoethylsulphonic acid
beta-Aminoethylsulfonate
beta-Aminoethylsulfonic acid
beta-Aminoethylsulphonate
beta-Aminoethylsulphonic acid
beta-aminoethylsulfonate
beta-aminoethylsulfonic acid
beta-aminoethylsulphonate
beta-aminoethylsulphonic acid
taurine
seed.compound:cpd00210
seedM:cpd00210
Taurine
2-Aminoethanesulfonic acid
2-aminoethanesulfonate
2-aminoethanesulfonic acid
Aminoethylsulfonic acid
aminoetylsulphonic acid
ethylaminesulphonic acid
taufon
tauphon
taur
taurine
sabiork.compound:1989
sabiorkM:1989
kegg.compound:C00245
keggC:C00245
Taurine
2-Aminoethanesulfonic acid
Aminoethylsulfonic acid
reactome:R-ALL-159420
reactomeM:R-ALL-159420
reactome:R-ALL-193513
reactomeM:R-ALL-193513
reactome:R-ALL-352014
reactomeM:R-ALL-352014
CHEBI:15891
chebi:15891
taurine
2-Aminoethanesulfonic acid
2-aminoethanesulfonic acid
2-aminoethyl sulfonate
Aminoethylsulfonic acid
Taurine
beta-aminoethylsulfonic acid
metacyc.compound:TAURINE
metacycM:TAURINE
taurine
2-aminoethanesulfonate
2-aminoethanesulfonic acid
aminoetylsulphonic acid
ethylaminesulphonic acid
taufon
tauphon
hmdb:HMDB00251
chebi:15195
chebi:26852
chebi:45877
chebi:9406
biggM:M_taur
keggC:M_C00245
keggD:M_D00047
seedM:M_cpd00210
secondary/obsolete/fantasy identifier