Feedback

N-(carboxyaminomethyl)urea

PropertiesImageOccurences in reactions
MNX_IDMNXM2841Image of MNXM2841
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC3H6N3O3
charge-1
mass132.09816
referencechebi:57415
InChIKeyHEQOQFYJHRGZCD-UHFFFAOYSA-M
InChIInChI=1S/C3H7N3O3/c4-2(7)5-1-6-3(8)9/h6H,1H2,(H,8,9)(H3,4,5,7)/p-1
SMILESNC(=O)NCNC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57415
chebi:57415
N-(carboxyaminomethyl)urea
(carbamoylamino)methylcarbamate
N-(carboxylatoaminomethyl)urea
kegg.compound:C06382
keggC:C06382
N-(Carboxyaminomethyl)urea
seed.compound:cpd03817
seedM:cpd03817
N-(Carboxyaminomethyl)urea
N-(carboxyaminomethyl)urea
metacyc.compound:CPD-14173
metacycM:CPD-14173
N-(carboxyaminomethyl)urea
CHEBI:15569
chebi:15569
N-(carboxyaminomethyl)urea
(carbamoylamino)methylcarbamic acid
N-(Carboxyaminomethyl)urea
[(aminocarbonyl)amino]methylcarbamic acid
[(carbamoylamino)methyl]carbamic acid
ureidomethylcarbamic acid
chebi:10837
chebi:12435
chebi:7095
keggC:M_C06382
seedM:M_cpd03817
secondary/obsolete/fantasy identifier