Feedback

N-acetyl-L-phosphinothricin

PropertiesImageOccurences in reactions
MNX_IDMNXM2844Image of MNXM2844
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC7H12NO5P
charge-2
mass221.147681
referencechebi:90940
InChIKeyVZVQOWUYAAWBCP-LURJTMIESA-L
InChIInChI=1S/C7H14NO5P/c1-5(9)8-6(7(10)11)3-4-14(2,12)13/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)(H,12,13)/p-2/t6-/m0/s1
SMILESCC(=O)N[C@@H](CCP(C)([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:90940
chebi:90940
N-acetyl-L-phosphinothricin
(2S)-2-acetamido-4-(methylphosphinato)butanoate
N-acetyl-L-phosphinothricin(2-)
envipath:...63e495804e7f
envipathM:...63e495804e7f
AE F099730 (NAG, L-2-acetamido-4-methylphosphinato-butyrate)
disodium L-2-acetamido-4-methylphosphinato-butyrate (NAG)
seed.compound:cpd17938
seedM:cpd17938
N-Acetylphinothricin
L-N-Acetylphosphinothricin
N-Acetyl-L-Glufosinate
N-Acetylphosphinothricin
N-acetylphosphinothricin
kegg.compound:C17952
keggC:C17952
N-Acetylphosphinothricin
L-N-Acetylphosphinothricin
N-Acetyl-L-Glufosinate
N-Acetylphinothricin
CHEBI:131436
chebi:131436
N-acetyl-L-phosphinothricin
(2S)-2-acetamido-4-(methylphosphinato)butanoic acid
L-N-Acetylphosphinothricin
N-Acetyl-L-Glufosinate
N-Acetylphinothricin
N-Acetylphosphinothricin
metacyc.compound:CPD-9999
metacycM:CPD-9999
N-acetylphosphinothricin
CHEBI:58879
chebi:58879
N-acetylphosphinothricin
2-acetamido-4-(methylphosphinato)butanoate
N-acetylphosphinothricin(2-)
CHEBI:52057
chebi:52057
N-acetylphosphinothricin
2-acetamido-4-[hydroxy(methyl)phosphoryl]butanoic acid
envipath:...0be254f498e0
envipathM:...0be254f498e0
compound 65
keggC:M_C17952
seedM:M_cpd17938
secondary/obsolete/fantasy identifier