Feedback

(Z)-2-phenyl-1-thioacetohydroximate

PropertiesImageOccurences in reactions
MNX_IDMNXM2856Image of MNXM2856
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 1
formulaC8H8NOS
charge-1
mass166.22126
referencechebi:58176
InChIKeyIHTJGIKQNHDTSX-UHFFFAOYSA-M
InChIInChI=1S/C8H9NOS/c10-9-8(11)6-7-4-2-1-3-5-7/h1-5,10H,6H2,(H,9,11)/p-1
SMILESO\N=C(/[S-])Cc1ccccc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58176
chebi:58176
(Z)-2-phenyl-1-thioacetohydroximate
2-phenylethanehydroximothioate
phenylthioacetohydroximate
phenylthioacetohydroximate cation
phenylthioacetohydroximate(1-)
metacyc.compound:PHENYLACETOTHIOHYDROXIMATE
metacycM:PHENYLACETOTHIOHYDROXIMATE
(Z)-2-phenyl-1-thioacetohydroximate
(Z)-N-hydroxy-2-phenylacetimidothioate
kegg.compound:C03719
keggC:C03719
Phenylacetothiohydroximate
(Z)-2-Phenyl-1-thioacetohydroximate
sabiork.compound:6815
sabiorkM:6815
Phenylthioacetohydroximate
seed.compound:cpd02332
seedM:cpd02332
Phenylthioacetohydroximate
(Z)-2-phenyl-1-thioacetohydroximate
(Z)-N-hydroxy-2-phenylacetimidothioate
2-phenyl-1-sulfanyl-ethanone oxime
N-hydroxy-2-phenylethanethioamide
N-hydroxy-2-phenylethanimidothioic acid
Phenylacetothiohydroximate
phenylacetothiohydroxamic acid
phenylacetothiohydroximate
phenylthioacetohydroximate
phenylthioacetohydroximic acid
CHEBI:17520
chebi:17520
phenylthioacetohydroximic acid
N-hydroxy-2-phenylethanimidothioic acid
Phenylthioacetohydroximate
chebi:14785
chebi:26011
chebi:8106
keggC:M_C03719
seedM:M_cpd02332
secondary/obsolete/fantasy identifier