Feedback

tropate

Properties
MNX_IDMNXM2872
formulaC9H9O3
charge-1
mass165.16596
referencechebi:17000
Image of MNXM2872
InChIKeyJACRWUWPXAESPB-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/p-1
SMILESOCC(C([O-])=O)c1ccccc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
envipath:...98b37d37ae1d Tropate
hmdb:HMDB0062590 Tropate
(+-)-Tropate
(+-)-Tropic acid
(+-)-tropic acid
2-Phenylhydracrylate
2-Phenylhydracrylic acid
3-Hydroxy-2-phenylpropionate
3-Hydroxy-2-phenylpropionic acid
3-hydroxy-2-phenylpropanoic acid
Tropic acid, (+-)-isomer
Tropic acid, (R)-isomer
Tropic acid, (S)-isomer
Tropic acid, monosodium salt
a-(Hydroxymethyl)benzeneacetate
a-(Hydroxymethyl)benzeneacetic acid
a-(Hydroxymethyl)phenylacetate
a-(Hydroxymethyl)phenylacetic acid
a-Phenyl-b-hydroxypropionate
a-Phenyl-b-hydroxypropionic acid
alpha-(Hydroxymethyl)benzeneacetate
alpha-(Hydroxymethyl)benzeneacetic acid
alpha-(Hydroxymethyl)phenylacetate
alpha-(Hydroxymethyl)phenylacetic acid
alpha-(hydroxymethyl)benzeneacetate
alpha-(hydroxymethyl)benzeneacetic acid
alpha-(hydroxymethyl)phenylacetate
alpha-(hydroxymethyl)phenylacetic acid
alpha-Phenyl-beta-hydroxypropionate
alpha-Phenyl-beta-hydroxypropionic acid
alpha-Phenylhydracrylic acid
alpha-phenyl-beta-hydroxypropionate
alpha-phenyl-beta-hydroxypropionic acid
b-Hydroxyhydratropate
b-Hydroxyhydratropic acid
beta-Hydroxyhydratropate
beta-Hydroxyhydratropic acid
beta-hydroxyhydratropate
beta-hydroxyhydratropic acid
chebi:17000 tropate
3-hydroxy-2-phenylpropanoate
chebi:30765 tropic acid
(+-)-tropic acid
2-phenylhydracrylic acid
3-hydroxy-2-phenylpropanoic acid
3-hydroxy-2-phenylpropionic acid
Tropic acid
alpha-(Hydroxymethyl)phenylacetic acid
alpha-(hydroxymethyl)benzeneacetic acid
alpha-phenyl-beta-hydroxypropionic acid
beta-hydroxyhydratropic acid
chebi:15268
chebi:27156
chebi:27157
chebi:9756
hmdb:HMDB62590
keggC:M_C01456
seedM:M_cpd01035
secondary/obsolete/fantasy identifier
keggC:C01456 Tropate
Tropic acid
alpha-(Hydroxymethyl)phenylacetic acid
seedM:cpd01035 Tropate
Tropic acid
alpha-(Hydroxymethyl)phenylacetic acid
tropate
metacycM:TROPATE tropate