Feedback

tropate

PropertiesImageOccurences in reactions
MNX_IDMNXM2872Image of MNXM2872
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC9H9O3
charge-1
mass165.05572
referencechebi:17000
InChIKeyJACRWUWPXAESPB-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/p-1
SMILESO=C([O-])C(CO)c1ccccc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17000
chebi:17000
tropate
3-hydroxy-2-phenylpropanoate
envipath:...98b37d37ae1d
envipathM:...98b37d37ae1d
Tropate
hmdb:HMDB0062590 Tropate
(+-)-Tropate
(+-)-Tropic acid
(+-)-tropic acid
2-Phenylhydracrylate
2-Phenylhydracrylic acid
3-Hydroxy-2-phenylpropionate
3-Hydroxy-2-phenylpropionic acid
3-hydroxy-2-phenylpropanoic acid
Tropic acid
Tropic acid, (+-)-isomer
Tropic acid, (R)-isomer
Tropic acid, (S)-isomer
Tropic acid, monosodium salt
a-(Hydroxymethyl)benzeneacetate
a-(Hydroxymethyl)benzeneacetic acid
a-(Hydroxymethyl)phenylacetate
a-(Hydroxymethyl)phenylacetic acid
a-Phenyl-b-hydroxypropionate
a-Phenyl-b-hydroxypropionic acid
alpha-(Hydroxymethyl)benzeneacetate
alpha-(Hydroxymethyl)benzeneacetic acid
alpha-(Hydroxymethyl)phenylacetate
alpha-(Hydroxymethyl)phenylacetic acid
alpha-(hydroxymethyl)benzeneacetate
alpha-(hydroxymethyl)benzeneacetic acid
alpha-(hydroxymethyl)phenylacetate
alpha-(hydroxymethyl)phenylacetic acid
alpha-Phenyl-beta-hydroxypropionate
alpha-Phenyl-beta-hydroxypropionic acid
alpha-Phenylhydracrylic acid
alpha-phenyl-beta-hydroxypropionate
alpha-phenyl-beta-hydroxypropionic acid
b-Hydroxyhydratropate
b-Hydroxyhydratropic acid
beta-Hydroxyhydratropate
beta-Hydroxyhydratropic acid
beta-hydroxyhydratropate
beta-hydroxyhydratropic acid
kegg.compound:C01456
keggC:C01456
Tropate
Tropic acid
alpha-(Hydroxymethyl)phenylacetic acid
seed.compound:cpd01035
seedM:cpd01035
Tropate
Tropic acid
alpha-(Hydroxymethyl)phenylacetic acid
tropate
metacyc.compound:TROPATE
metacycM:TROPATE
tropate
CHEBI:30765
chebi:30765
tropic acid
(+-)-tropic acid
2-phenylhydracrylic acid
3-hydroxy-2-phenylpropanoic acid
3-hydroxy-2-phenylpropionic acid
Tropic acid
alpha-(Hydroxymethyl)phenylacetic acid
alpha-(hydroxymethyl)benzeneacetic acid
alpha-phenyl-beta-hydroxypropionic acid
beta-hydroxyhydratropic acid
hmdb:HMDB62590
chebi:15268
chebi:27156
chebi:27157
chebi:9756
keggC:M_C01456
seedM:M_cpd01035
secondary/obsolete/fantasy identifier