|
![]() |
InChIKey | KWGRBVOPPLSCSI-WPRPVWTQSA-O |
InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/p+1/t8-,10-/m0/s1 |
SMILES | C[NH2+][C@@H](C)[C@H](O)c1ccccc1 |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 3 |
Distinct compatimentalized reactions in models | 0 |
Identifier | Description |
---|---|
keggC:C01575 | Ephedrine (-)-Ephedrine L-Ephedrine |
hmdb:HMDB0015451 | Ephedrine (1R,2S)-1-Phenyl-1-hydroxy-2-methylaminopropane (1R,2S)-2-(methylamino)-1-phenylpropan-1-ol Ephedrine erythro isomer Ephedrine hydrochloride Ephedrine renaudin Ephedrine sulfate Hydrochloride, ephedrine L(-)-Ephedrine L-Ephedrine L-erythro-2-(methylamino)-1-Phenylpropan-1-ol Renaudin brand OF ephedrine hydrochloride Renaudin, ephedrine Sal phedrine Sal-phedrine SalPhedrine Sulfate, ephedrine Wendt brand OF ephedrine sulfate ephedrine erythro Isomer OF ephedrine |
keggD:D00124 | Ephedrine (USP) Ephedrine (TN) |
metacycM:--EPHEDRINE | (-)-ephedrine -(1R,2S)-(-)-ephedrine |
chebi:15407 | (-)-ephedrine (-)-Ephedrine (1R,2S)-1-phenyl-1-hydroxy-2-methylaminopropane (1R,2S)-2-(methylamino)-1-phenylpropan-1-ol Ephedrine L(-)-ephedrine L-Ephedrine L-erythro-2-(methylamino)-1-phenylpropan-1-ol l-ephedrine |
chebi:57295 | (1R,2S)-ephedrine (-)-ephedrinium (1R,2S)-1-hydroxy-N-methyl-1-phenylpropan-2-aminium |
chebi:10776 chebi:132176 chebi:18483 chebi:4801 hmdb:HMDB15451 keggC:M_C01575 keggD:M_D00124 seedM:M_cpd01109 | secondary/obsolete/fantasy identifier |
seedM:cpd01109 | Ephedrine (-)-Ephedrine (-)-ephedrine -(1R,2S)-(-)-ephedrine L-Ephedrine |
MNXM92309 | is deprecated and replaced by this entry |