Feedback

2-phospho-L-lactic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM2888Image of MNXM2888
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 2
formulaC3H4O6P
charge-3
mass167.034021
referencechebi:45013
InChIKeyCSZRNWHGZPKNKY-REOHCLBHSA-K
InChIInChI=1S/C3H7O6P/c1-2(3(4)5)9-10(6,7)8/h2H,1H3,(H,4,5)(H2,6,7,8)/p-3/t2-/m0/s1
SMILESC[C@H](OP([O-])([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:45013
chebi:45013
2-phospho-L-lactic acid
(2S)-2-(phosphonooxy)propanoic acid
(2S)-2-phospholactic acid
L-PHOSPHOLACTATE
L-phospholactic acid
phospho-L-lactic acid
sabiork.compound:28542
sabiorkM:28542
kegg.compound:C19156
keggC:C19156
(2S)-2-Phospholactate
seed.compound:cpd20414
seedM:cpd20414
(2S)-2-Phospholactate
phosphopyruvate
CHEBI:59906
chebi:59906
(2S)-2-phospholactate
(2S)-2-(phosphonatooxy)propanoate
(2S)-2-(phosphonatooxy)propionate
2-phosphonato-L-lactate trianion
2-phosphonato-L-lactate(3-)
metacyc.compound:S-PHOSPHOLACTATE
metacycM:S-PHOSPHOLACTATE
seed.compound:cpd28137
seedM:cpd28137
(2S)-2-phospholactate
(S)-phospholactate
(S)-phospholactic acid
L-phospholactate
L-phospholactic acid
bigg.metabolite:2plac__L
biggM:2plac__L
2-phospho-L-lactate
CHEBI:59433
chebi:59433
2-phospho-L-lactate
(2S)-2-[(hydroxyphosphinato)oxy]propanoate
(2S)-2-phospholactate
(2S)-2-phospholactate dianion
(2S)-2-phospholactate(2-)
2-phospho-L-lactate dianion
2-phospho-L-lactate(2-)
seed.compound:cpd15809
seedM:cpd15809
2-phospho-L-lactate
2plac-L
biggM:M_2plac__L
keggC:M_C19156
seedM:M_cpd15809
seedM:M_cpd20414
seedM:M_cpd28137
secondary/obsolete/fantasy identifier