Feedback

2-phospho-L-lactic acid

Properties
MNX_IDMNXM2888
formulaC3H7O6P
charge0
mass170.057841
referencechebi:45013
Image of MNXM2888
InChIKeyCSZRNWHGZPKNKY-REOHCLBHSA-N
InChIInChI=1S/C3H7O6P/c1-2(3(4)5)9-10(6,7)8/h2H,1H3,(H,4,5)(H2,6,7,8)/t2-/m0/s1
SMILESC[C@H](OP(O)(O)=O)C(O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd15809 2-phospho-L-lactate
2plac-L
chebi:45013 2-phospho-L-lactic acid
(2S)-2-(phosphonooxy)propanoic acid
(2S)-2-phospholactic acid
L-PHOSPHOLACTATE
L-phospholactic acid
phospho-L-lactic acid
chebi:59433 2-phospho-L-lactate
(2S)-2-[(hydroxyphosphinato)oxy]propanoate
(2S)-2-phospholactate
(2S)-2-phospholactate dianion
(2S)-2-phospholactate(2-)
2-phospho-L-lactate dianion
2-phospho-L-lactate(2-)
keggC:C19156
sabiorkM:28542
(2S)-2-Phospholactate
metacycM:S-PHOSPHOLACTATE
seedM:cpd28137
(2S)-2-phospholactate
(S)-phospholactate
(S)-phospholactic acid
L-phospholactate
L-phospholactic acid
seedM:cpd20414 (2S)-2-Phospholactate
phosphopyruvate
chebi:59906 (2S)-2-phospholactate
(2S)-2-(phosphonatooxy)propanoate
(2S)-2-(phosphonatooxy)propionate
2-phosphonato-L-lactate trianion
2-phosphonato-L-lactate(3-)
biggM:M_2plac__L
keggC:M_C19156
seedM:M_cpd15809
seedM:M_cpd20414
seedM:M_cpd28137
secondary/obsolete/fantasy identifier
biggM:2plac__L 2-phospho-L-lactate