Feedback

(3R,6S)-6-hydroxy-3,7-dimethyloctanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2890Image of MNXM2890
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC10H19O3
charge-1
mass187.25606
referencechebi:64221
InChIKeyIQBGVZDRJBTLDN-BDAKNGLRSA-M
InChIInChI=1S/C10H20O3/c1-7(2)9(11)5-4-8(3)6-10(12)13/h7-9,11H,4-6H2,1-3H3,(H,12,13)/p-1/t8-,9+/m1/s1
SMILESCC(C)[C@@H](O)CC[C@@H](C)CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
metacyc.compound:CPD-15179
metacycM:CPD-15179
seed.compound:cpd32610
seedM:cpd32610
CHEBI:64221
chebi:64221
(3R,6S)-6-hydroxy-3,7-dimethyloctanoate
CHEBI:64265
chebi:64265
(3R,6S)-6-hydroxy-3,7-dimethyloctanoic acid
seed.compound:cpd18049
seedM:cpd18049
kegg.compound:C18067
keggC:C18067
6-Hydroxy-3,7-dimethyloctanoate
seed.compound:cpd22186
seedM:cpd22186
6-Hydroxy-37-dimethyloctanoate
CHEBI:64223
chebi:64223
6-hydroxy-3,7-dimethyloctanoate
CHEBI:50451
chebi:50451
6-hydroxy-3,7-dimethyloctanoic acid
lipidmaps:LMFA01050370
lipidmapsM:LMFA01050370
6-hydroxy-3,7-dimethyloctanoic acid
6-hydroxy-3,7-dimethyloctanoic acid
FA(10:0(OH))
metacyc.compound:6-Hydroxy-37-dimethyloctanoate
metacycM:6-Hydroxy-37-dimethyloctanoate
a 6-hydroxy-3,7-dimethyloctanoate
keggC:M_C18067
seedM:M_cpd18049
seedM:M_cpd22186
seedM:M_cpd32610
secondary/obsolete/fantasy identifier