Feedback

(3S,6R)-6-hydroxy-3-isopropenylheptanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2891Image of MNXM2891
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC10H17O3
charge-1
mass185.24018
referencechebi:64226
InChIKeyNQYDFAGFKCSWGI-BDAKNGLRSA-M
InChIInChI=1S/C10H18O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h8-9,11H,1,4-6H2,2-3H3,(H,12,13)/p-1/t8-,9+/m1/s1
SMILESC[C@@H](O)CC[C@@H](CC([O-])=O)C(C)=C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:64226
chebi:64226
(3S,6R)-6-hydroxy-3-isopropenylheptanoate
(3S,6R)-6-hydroxy-3-(prop-1-en-2-yl)heptanoate
(3S,6R)-6-hydroxy-3-isopropenylheptanoate(1-)
seed.compound:cpd08271
seedM:cpd08271
CHEBI:214
chebi:214
kegg.compound:C11417
keggC:C11417
(3S)-6-Hydroxy-3-isopropenyl-heptanoate
6-Hydroxy-3-isopropenylheptanoate
metacyc.compound:CPD-10065
metacycM:CPD-10065
seed.compound:cpd22540
seedM:cpd22540
(3S,6R)-6-hydroxy-3-isopropenyl-heptanoate
CHEBI:64249
chebi:64249
(3S,6R)-6-hydroxy-3-isopropenylheptanoic acid
(3S,6R)-6-hydroxy-3-(prop-1-en-2-yl)heptanoic acid
keggC:M_C11417
seedM:M_cpd08271
seedM:M_cpd22540
secondary/obsolete/fantasy identifier